C13H15N3O2S — CID 3004205
N-(2-ethylphenyl)-3-(2-sulfanylidene-3H-1,3,4-oxadiazol-5-yl)propanamide (PubChem CID 3004205) has the molecular formula C13H15N3O2S and a molecular weight of 277.35 g/mol. Its IUPAC name is N-(2-ethylphenyl)-3-(2-sulfanylidene-3H-1,3,4-oxadiazol-5-yl)propanamide.
| Compound Name | N-(2-ethylphenyl)-3-(2-sulfanylidene-3H-1,3,4-oxadiazol-5-yl)propanamide |
|---|---|
| PubChem CID | 3004205 |
| Molecular Formula | C13H15N3O2S |
| Molecular Weight | 277.35 g/mol |
| Exact Mass | 277.09 |
| IUPAC Name | N-(2-ethylphenyl)-3-(2-sulfanylidene-3H-1,3,4-oxadiazol-5-yl)propanamide |
| SMILES | CCc1ccccc1NC(=O)CCc1n[nH]c(=S)o1 |
| InChI | InChI=1S/C13H15N3O2S/c1-2-9-5-3-4-6-10(9)14-11(17)7-8-12-15-16-13(19)18-12/h3-6H,2,7-8H2,1H3,(H,14,17)(H,16,19) |
| InChIKey | WWLJKDTZCZTUCM-UHFFFAOYSA-N |
| XLogP | 2.87 |
| TPSA | 70.92 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 277.35 |
| LogP ≤ 5 | 2.87 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|