C16H21N3S — CID 3004328
3-phenyl-3,3a,4,5,6,7,8,9-octahydrocycloocta[c]pyrazole-2-carbothioamide (PubChem CID 3004328) has the molecular formula C16H21N3S and a molecular weight of 287.43 g/mol. Its IUPAC name is 3-phenyl-3,3a,4,5,6,7,8,9-octahydrocycloocta[c]pyrazole-2-carbothioamide.
| Compound Name | 3-phenyl-3,3a,4,5,6,7,8,9-octahydrocycloocta[c]pyrazole-2-carbothioamide |
|---|---|
| PubChem CID | 3004328 |
| Molecular Formula | C16H21N3S |
| Molecular Weight | 287.43 g/mol |
| Exact Mass | 287.15 |
| IUPAC Name | 3-phenyl-3,3a,4,5,6,7,8,9-octahydrocycloocta[c]pyrazole-2-carbothioamide |
| SMILES | NC(=S)N1N=C2CCCCCCC2C1c1ccccc1 |
| InChI | InChI=1S/C16H21N3S/c17-16(20)19-15(12-8-4-3-5-9-12)13-10-6-1-2-7-11-14(13)18-19/h3-5,8-9,13,15H,1-2,6-7,10-11H2,(H2,17,20) |
| InChIKey | LZUFXUCJBCSOMY-UHFFFAOYSA-N |
| XLogP | 3.61 |
| TPSA | 41.62 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 287.43 |
| LogP ≤ 5 | 3.61 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|