C10H9Cl2N3OS2 — CID 30043620
5-[2-(2,6-dichlorophenoxy)ethylsulfanyl]-1,3,4-thiadiazol-2-amine (PubChem CID 30043620) has the molecular formula C10H9Cl2N3OS2 and a molecular weight of 322.24 g/mol. Its IUPAC name is 5-[2-(2,6-dichlorophenoxy)ethylsulfanyl]-1,3,4-thiadiazol-2-amine.
| Compound Name | 5-[2-(2,6-dichlorophenoxy)ethylsulfanyl]-1,3,4-thiadiazol-2-amine |
|---|---|
| PubChem CID | 30043620 |
| Molecular Formula | C10H9Cl2N3OS2 |
| Molecular Weight | 322.24 g/mol |
| Exact Mass | 320.96 |
| IUPAC Name | 5-[2-(2,6-dichlorophenoxy)ethylsulfanyl]-1,3,4-thiadiazol-2-amine |
| SMILES | Nc1nnc(SCCOc2c(Cl)cccc2Cl)s1 |
| InChI | InChI=1S/C10H9Cl2N3OS2/c11-6-2-1-3-7(12)8(6)16-4-5-17-10-15-14-9(13)18-10/h1-3H,4-5H2,(H2,13,14) |
| InChIKey | DCTRIMRWMBEHBZ-UHFFFAOYSA-N |
| XLogP | 3.60 |
| TPSA | 61.03 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 322.24 |
| LogP ≤ 5 | 3.60 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|