About (2E,6E)-2,6-bis(1-phenylethylidene)cyclohexan-1-one
(2E,6E)-2,6-bis(1-phenylethylidene)cyclohexan-1-one (PubChem CID 3004411) has the molecular formula C22H22O
and a molecular weight of 302.42 g/mol. Its IUPAC name is (2E,6E)-2,6-bis(1-phenylethylidene)cyclohexan-1-one.
Molecular Properties
| Compound Name | (2E,6E)-2,6-bis(1-phenylethylidene)cyclohexan-1-one |
| PubChem CID | 3004411 |
| Molecular Formula | C22H22O |
| Molecular Weight | 302.42 g/mol |
| Exact Mass | 302.17 |
| IUPAC Name | (2E,6E)-2,6-bis(1-phenylethylidene)cyclohexan-1-one |
| SMILES | C/C(=C1/CCC/C(=C(/C)c2ccccc2)C1=O)c1ccccc1 |
| InChI | InChI=1S/C22H22O/c1-16(18-10-5-3-6-11-18)20-14-9-15-21(22(20)23)17(2)19-12-7-4-8-13-19/h3-8,10-13H,9,14-15H2,1-2H3/b20-16+,21-17+ |
| InChIKey | KSRIHQAATHFAEP-NWILIBCHSA-N |
| XLogP | 5.69 |
| TPSA | 17.07 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 23 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 302.42 |
| LogP ≤ 5 | 5.69 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'ene_one_ene_A(57)', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|
Analyze (2E,6E)-2,6-bis(1-phenylethylidene)cyclohexan-1-one with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (2E,6E)-2,6-bis(1-phenylethylidene)cyclohexan-1-one?
The IUPAC name of (2E,6E)-2,6-bis(1-phenylethylidene)cyclohexan-1-one (CID 3004411) is (2E,6E)-2,6-bis(1-phenylethylidene)cyclohexan-1-one.
What is the SMILES notation for (2E,6E)-2,6-bis(1-phenylethylidene)cyclohexan-1-one?
The canonical SMILES for (2E,6E)-2,6-bis(1-phenylethylidene)cyclohexan-1-one is C/C(=C1/CCC/C(=C(/C)c2ccccc2)C1=O)c1ccccc1.
What is the InChIKey of (2E,6E)-2,6-bis(1-phenylethylidene)cyclohexan-1-one?
The InChIKey is KSRIHQAATHFAEP-NWILIBCHSA-N. The full InChI is InChI=1S/C22H22O/c1-16(18-10-5-3-6-11-18)20-14-9-15-21(22(20)23)17(2)19-12-7-4-8-13-19/h3-8,10-13H,9,14-15H2,1-2H3/b20-16+,21-17+.
What are the key properties of (2E,6E)-2,6-bis(1-phenylethylidene)cyclohexan-1-one?
(2E,6E)-2,6-bis(1-phenylethylidene)cyclohexan-1-one has a molecular weight of 302.42 g/mol, XLogP of 5.69, 2 rotatable bonds, 0 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for (2E,6E)-2,6-bis(1-phenylethylidene)cyclohexan-1-one is sourced from PubChem (CID 3004411), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).