About (2E)-2-(2,3,3-trichloro-1-nitroprop-2-enylidene)-1,3-thiazolidine
(2E)-2-(2,3,3-trichloro-1-nitroprop-2-enylidene)-1,3-thiazolidine (PubChem CID 3004958) has the molecular formula C6H5Cl3N2O2S
and a molecular weight of 275.54 g/mol. Its IUPAC name is (2E)-2-(2,3,3-trichloro-1-nitroprop-2-enylidene)-1,3-thiazolidine.
Molecular Properties
| Compound Name | (2E)-2-(2,3,3-trichloro-1-nitroprop-2-enylidene)-1,3-thiazolidine |
| PubChem CID | 3004958 |
| Molecular Formula | C6H5Cl3N2O2S |
| Molecular Weight | 275.54 g/mol |
| Exact Mass | 273.91 |
| IUPAC Name | (2E)-2-(2,3,3-trichloro-1-nitroprop-2-enylidene)-1,3-thiazolidine |
| SMILES | O=[N+]([O-])/C(C(Cl)=C(Cl)Cl)=C1\NCCS1 |
| InChI | InChI=1S/C6H5Cl3N2O2S/c7-3(5(8)9)4(11(12)13)6-10-1-2-14-6/h10H,1-2H2/b6-4+ |
| InChIKey | ZWNXZDZJPQZAAK-GQCTYLIASA-N |
| XLogP | 2.65 |
| TPSA | 55.17 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 14 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 275.54 |
| LogP ≤ 5 | 2.65 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|
Analyze (2E)-2-(2,3,3-trichloro-1-nitroprop-2-enylidene)-1,3-thiazolidine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (2E)-2-(2,3,3-trichloro-1-nitroprop-2-enylidene)-1,3-thiazolidine?
The IUPAC name of (2E)-2-(2,3,3-trichloro-1-nitroprop-2-enylidene)-1,3-thiazolidine (CID 3004958) is (2E)-2-(2,3,3-trichloro-1-nitroprop-2-enylidene)-1,3-thiazolidine.
What is the SMILES notation for (2E)-2-(2,3,3-trichloro-1-nitroprop-2-enylidene)-1,3-thiazolidine?
The canonical SMILES for (2E)-2-(2,3,3-trichloro-1-nitroprop-2-enylidene)-1,3-thiazolidine is O=[N+]([O-])/C(C(Cl)=C(Cl)Cl)=C1\NCCS1.
What is the InChIKey of (2E)-2-(2,3,3-trichloro-1-nitroprop-2-enylidene)-1,3-thiazolidine?
The InChIKey is ZWNXZDZJPQZAAK-GQCTYLIASA-N. The full InChI is InChI=1S/C6H5Cl3N2O2S/c7-3(5(8)9)4(11(12)13)6-10-1-2-14-6/h10H,1-2H2/b6-4+.
What are the key properties of (2E)-2-(2,3,3-trichloro-1-nitroprop-2-enylidene)-1,3-thiazolidine?
(2E)-2-(2,3,3-trichloro-1-nitroprop-2-enylidene)-1,3-thiazolidine has a molecular weight of 275.54 g/mol, XLogP of 2.65, 2 rotatable bonds, 1 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for (2E)-2-(2,3,3-trichloro-1-nitroprop-2-enylidene)-1,3-thiazolidine is sourced from PubChem (CID 3004958), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).