C13H20O4S2 — CID 3004985
dimethyl (8Z)-8,9-dimethyl-2,3,4,7-tetrahydro-1,5-dithionine-6,6-dicarboxylate (PubChem CID 3004985) has the molecular formula C13H20O4S2 and a molecular weight of 304.43 g/mol. Its IUPAC name is dimethyl (8Z)-8,9-dimethyl-2,3,4,7-tetrahydro-1,5-dithionine-6,6-dicarboxylate.
| Compound Name | dimethyl (8Z)-8,9-dimethyl-2,3,4,7-tetrahydro-1,5-dithionine-6,6-dicarboxylate |
|---|---|
| PubChem CID | 3004985 |
| Molecular Formula | C13H20O4S2 |
| Molecular Weight | 304.43 g/mol |
| Exact Mass | 304.08 |
| IUPAC Name | dimethyl (8Z)-8,9-dimethyl-2,3,4,7-tetrahydro-1,5-dithionine-6,6-dicarboxylate |
| SMILES | COC(=O)C1(C(=O)OC)C/C(C)=C(/C)SCCCS1 |
| InChI | InChI=1S/C13H20O4S2/c1-9-8-13(11(14)16-3,12(15)17-4)19-7-5-6-18-10(9)2/h5-8H2,1-4H3/b10-9- |
| InChIKey | VPUNJGUYMDEJTM-KTKRTIGZSA-N |
| XLogP | 2.63 |
| TPSA | 52.60 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 304.43 |
| LogP ≤ 5 | 2.63 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'} |
|---|