C30H28N4OS — CID 3005095
(2Z)-2-(2-morpholin-4-ylcyclopent-2-en-1-ylidene)-4-N,5-N,3-triphenyl-1,3-thiazolidine-4,5-diimine (PubChem CID 3005095) has the molecular formula C30H28N4OS and a molecular weight of 492.65 g/mol. Its IUPAC name is (2Z)-2-(2-morpholin-4-ylcyclopent-2-en-1-ylidene)-4-N,5-N,3-triphenyl-1,3-thiazolidine-4,5-diimine.
| Compound Name | (2Z)-2-(2-morpholin-4-ylcyclopent-2-en-1-ylidene)-4-N,5-N,3-triphenyl-1,3-thiazolidine-4,5-diimine |
|---|---|
| PubChem CID | 3005095 |
| Molecular Formula | C30H28N4OS |
| Molecular Weight | 492.65 g/mol |
| Exact Mass | 492.20 |
| IUPAC Name | (2Z)-2-(2-morpholin-4-ylcyclopent-2-en-1-ylidene)-4-N,5-N,3-triphenyl-1,3-thiazolidine-4,5-diimine |
| SMILES | C1=C(N2CCOCC2)/C(=C2\SC(=N\c3ccccc3)/C(=N\c3ccccc3)N2c2ccccc2)CC1 |
| InChI | InChI=1S/C30H28N4OS/c1-4-11-23(12-5-1)31-28-29(32-24-13-6-2-7-14-24)36-30(34(28)25-15-8-3-9-16-25)26-17-10-18-27(26)33-19-21-35-22-20-33/h1-9,11-16,18H,10,17,19-22H2/b30-26-,31-28+,32-29- |
| InChIKey | NCJVLFFKSDUQSL-UXJVWMGRSA-N |
| XLogP | 6.92 |
| TPSA | 40.43 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 36 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 492.65 |
| LogP ≤ 5 | 6.92 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|