C8H6Cl2F3N — CID 30051717
3,5-dichloro-N-(2,2,2-trifluoroethyl)aniline (PubChem CID 30051717) has the molecular formula C8H6Cl2F3N and a molecular weight of 244.04 g/mol. Its IUPAC name is 3,5-dichloro-N-(2,2,2-trifluoroethyl)aniline.
| Compound Name | 3,5-dichloro-N-(2,2,2-trifluoroethyl)aniline |
|---|---|
| PubChem CID | 30051717 |
| Molecular Formula | C8H6Cl2F3N |
| Molecular Weight | 244.04 g/mol |
| Exact Mass | 242.98 |
| IUPAC Name | 3,5-dichloro-N-(2,2,2-trifluoroethyl)aniline |
| SMILES | FC(F)(F)CNc1cc(Cl)cc(Cl)c1 |
| InChI | InChI=1S/C8H6Cl2F3N/c9-5-1-6(10)3-7(2-5)14-4-8(11,12)13/h1-3,14H,4H2 |
| InChIKey | STMGXIZOQUSLLR-UHFFFAOYSA-N |
| XLogP | 3.97 |
| TPSA | 12.03 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 244.04 |
| LogP ≤ 5 | 3.97 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |