C19H24N6OS3 — CID 3005200
1-benzyl-3-[[2-(cyclohexylcarbamothioylamino)-1,3-thiazole-4-carbonyl]amino]thiourea (PubChem CID 3005200) has the molecular formula C19H24N6OS3 and a molecular weight of 448.64 g/mol. Its IUPAC name is 1-benzyl-3-[[2-(cyclohexylcarbamothioylamino)-1,3-thiazole-4-carbonyl]amino]thiourea.
| Compound Name | 1-benzyl-3-[[2-(cyclohexylcarbamothioylamino)-1,3-thiazole-4-carbonyl]amino]thiourea |
|---|---|
| PubChem CID | 3005200 |
| Molecular Formula | C19H24N6OS3 |
| Molecular Weight | 448.64 g/mol |
| Exact Mass | 448.12 |
| IUPAC Name | 1-benzyl-3-[[2-(cyclohexylcarbamothioylamino)-1,3-thiazole-4-carbonyl]amino]thiourea |
| SMILES | O=C(NNC(=S)NCc1ccccc1)c1csc(NC(=S)NC2CCCCC2)n1 |
| InChI | InChI=1S/C19H24N6OS3/c26-16(24-25-17(27)20-11-13-7-3-1-4-8-13)15-12-29-19(22-15)23-18(28)21-14-9-5-2-6-10-14/h1,3-4,7-8,12,14H,2,5-6,9-11H2,(H,24,26)(H2,20,25,27)(H2,21,22,23,28) |
| InChIKey | SLPDUWREUUGTTF-UHFFFAOYSA-N |
| XLogP | 3.07 |
| TPSA | 90.11 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 448.64 |
| LogP ≤ 5 | 3.07 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|