About N-(5-bromo-2-pyridinyl)-N',N'-dimethylethane-1,2-diamine
N-(5-bromo-2-pyridinyl)-N',N'-dimethylethane-1,2-diamine (PubChem CID 30052087) has the molecular formula C9H14BrN3
and a molecular weight of 244.14 g/mol. Its IUPAC name is N-(5-bromo-2-pyridinyl)-N',N'-dimethylethane-1,2-diamine.
Molecular Properties
| Compound Name | N-(5-bromo-2-pyridinyl)-N',N'-dimethylethane-1,2-diamine |
| PubChem CID | 30052087 |
| Molecular Formula | C9H14BrN3 |
| Molecular Weight | 244.14 g/mol |
| Exact Mass | 243.04 |
| IUPAC Name | N-(5-bromo-2-pyridinyl)-N',N'-dimethylethane-1,2-diamine |
| SMILES | CN(C)CCNc1ccc(Br)cn1 |
| InChI | InChI=1S/C9H14BrN3/c1-13(2)6-5-11-9-4-3-8(10)7-12-9/h3-4,7H,5-6H2,1-2H3,(H,11,12) |
| InChIKey | YZNKVSIFLBFINU-UHFFFAOYSA-N |
| XLogP | 1.82 |
| TPSA | 28.16 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 13 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 244.14 |
| LogP ≤ 5 | 1.82 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze N-(5-bromo-2-pyridinyl)-N',N'-dimethylethane-1,2-diamine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of N-(5-bromo-2-pyridinyl)-N',N'-dimethylethane-1,2-diamine?
The IUPAC name of N-(5-bromo-2-pyridinyl)-N',N'-dimethylethane-1,2-diamine (CID 30052087) is N-(5-bromo-2-pyridinyl)-N',N'-dimethylethane-1,2-diamine.
What is the SMILES notation for N-(5-bromo-2-pyridinyl)-N',N'-dimethylethane-1,2-diamine?
The canonical SMILES for N-(5-bromo-2-pyridinyl)-N',N'-dimethylethane-1,2-diamine is CN(C)CCNc1ccc(Br)cn1.
What is the InChIKey of N-(5-bromo-2-pyridinyl)-N',N'-dimethylethane-1,2-diamine?
The InChIKey is YZNKVSIFLBFINU-UHFFFAOYSA-N. The full InChI is InChI=1S/C9H14BrN3/c1-13(2)6-5-11-9-4-3-8(10)7-12-9/h3-4,7H,5-6H2,1-2H3,(H,11,12).
What are the key properties of N-(5-bromo-2-pyridinyl)-N',N'-dimethylethane-1,2-diamine?
N-(5-bromo-2-pyridinyl)-N',N'-dimethylethane-1,2-diamine has a molecular weight of 244.14 g/mol, XLogP of 1.82, 4 rotatable bonds, 1 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for N-(5-bromo-2-pyridinyl)-N',N'-dimethylethane-1,2-diamine is sourced from PubChem (CID 30052087), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).