C18H27NOS — CID 3005498
N-[[(1R,5R)-5-hydroxy-1,3,3-trimethylcyclohexyl]methyl]-2-methylbenzenecarbothioamide (PubChem CID 3005498) has the molecular formula C18H27NOS and a molecular weight of 305.49 g/mol. Its IUPAC name is N-[[(1R,5R)-5-hydroxy-1,3,3-trimethylcyclohexyl]methyl]-2-methylbenzenecarbothioamide.
| Compound Name | N-[[(1R,5R)-5-hydroxy-1,3,3-trimethylcyclohexyl]methyl]-2-methylbenzenecarbothioamide |
|---|---|
| PubChem CID | 3005498 |
| Molecular Formula | C18H27NOS |
| Molecular Weight | 305.49 g/mol |
| Exact Mass | 305.18 |
| IUPAC Name | N-[[(1R,5R)-5-hydroxy-1,3,3-trimethylcyclohexyl]methyl]-2-methylbenzenecarbothioamide |
| SMILES | Cc1ccccc1C(=S)NC[C@@]1(C)C[C@H](O)CC(C)(C)C1 |
| InChI | InChI=1S/C18H27NOS/c1-13-7-5-6-8-15(13)16(21)19-12-18(4)10-14(20)9-17(2,3)11-18/h5-8,14,20H,9-12H2,1-4H3,(H,19,21)/t14-,18+/m1/s1 |
| InChIKey | SFYGXVFIWZJQCK-KDOFPFPSSA-N |
| XLogP | 3.84 |
| TPSA | 32.26 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 305.49 |
| LogP ≤ 5 | 3.84 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|