About 5-[(2-hydroxyphenyl)methylidene]-2-sulfanylideneimidazolidin-4-one;piperidine
5-[(2-hydroxyphenyl)methylidene]-2-sulfanylideneimidazolidin-4-one;piperidine (PubChem CID 3005817) has the molecular formula C15H19N3O2S
and a molecular weight of 305.40 g/mol. Its IUPAC name is 5-[(2-hydroxyphenyl)methylidene]-2-sulfanylideneimidazolidin-4-one;piperidine.
Molecular Properties
| Compound Name | 5-[(2-hydroxyphenyl)methylidene]-2-sulfanylideneimidazolidin-4-one;piperidine |
| PubChem CID | 3005817 |
| Molecular Formula | C15H19N3O2S |
| Molecular Weight | 305.40 g/mol |
| Exact Mass | 305.12 |
| IUPAC Name | 5-[(2-hydroxyphenyl)methylidene]-2-sulfanylideneimidazolidin-4-one;piperidine |
| SMILES | C1CCNCC1.O=C1NC(=S)NC1=Cc1ccccc1O |
| InChI | InChI=1S/C10H8N2O2S.C5H11N/c13-8-4-2-1-3-6(8)5-7-9(14)12-10(15)11-7;1-2-4-6-5-3-1/h1-5,13H,(H2,11,12,14,15);6H,1-5H2 |
| InChIKey | KDYCAJZAFGCPTM-UHFFFAOYSA-N |
| XLogP | 1.50 |
| TPSA | 73.39 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 21 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 305.40 |
| LogP ≤ 5 | 1.50 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|
Analyze 5-[(2-hydroxyphenyl)methylidene]-2-sulfanylideneimidazolidin-4-one;piperidine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 5-[(2-hydroxyphenyl)methylidene]-2-sulfanylideneimidazolidin-4-one;piperidine?
The IUPAC name of 5-[(2-hydroxyphenyl)methylidene]-2-sulfanylideneimidazolidin-4-one;piperidine (CID 3005817) is 5-[(2-hydroxyphenyl)methylidene]-2-sulfanylideneimidazolidin-4-one;piperidine.
What is the SMILES notation for 5-[(2-hydroxyphenyl)methylidene]-2-sulfanylideneimidazolidin-4-one;piperidine?
The canonical SMILES for 5-[(2-hydroxyphenyl)methylidene]-2-sulfanylideneimidazolidin-4-one;piperidine is C1CCNCC1.O=C1NC(=S)NC1=Cc1ccccc1O.
What is the InChIKey of 5-[(2-hydroxyphenyl)methylidene]-2-sulfanylideneimidazolidin-4-one;piperidine?
The InChIKey is KDYCAJZAFGCPTM-UHFFFAOYSA-N. The full InChI is InChI=1S/C10H8N2O2S.C5H11N/c13-8-4-2-1-3-6(8)5-7-9(14)12-10(15)11-7;1-2-4-6-5-3-1/h1-5,13H,(H2,11,12,14,15);6H,1-5H2.
What are the key properties of 5-[(2-hydroxyphenyl)methylidene]-2-sulfanylideneimidazolidin-4-one;piperidine?
5-[(2-hydroxyphenyl)methylidene]-2-sulfanylideneimidazolidin-4-one;piperidine has a molecular weight of 305.40 g/mol, XLogP of 1.50, 1 rotatable bonds, 4 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 5-[(2-hydroxyphenyl)methylidene]-2-sulfanylideneimidazolidin-4-one;piperidine is sourced from PubChem (CID 3005817), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).