C32H30N2O10 — CID 3005844
[(2R,3R,4S,5R,6R)-3,4,5-triacetyloxy-6-(3-cyano-2-oxo-4,6-diphenyl-1-pyridinyl)oxan-2-yl]methyl acetate (PubChem CID 3005844) has the molecular formula C32H30N2O10 and a molecular weight of 602.60 g/mol. Its IUPAC name is [(2R,3R,4S,5R,6R)-3,4,5-triacetyloxy-6-(3-cyano-2-oxo-4,6-diphenyl-1-pyridinyl)oxan-2-yl]methyl acetate.
| Compound Name | [(2R,3R,4S,5R,6R)-3,4,5-triacetyloxy-6-(3-cyano-2-oxo-4,6-diphenyl-1-pyridinyl)oxan-2-yl]methyl acetate |
|---|---|
| PubChem CID | 3005844 |
| Molecular Formula | C32H30N2O10 |
| Molecular Weight | 602.60 g/mol |
| Exact Mass | 602.19 |
| IUPAC Name | [(2R,3R,4S,5R,6R)-3,4,5-triacetyloxy-6-(3-cyano-2-oxo-4,6-diphenyl-1-pyridinyl)oxan-2-yl]methyl acetate |
| SMILES | CC(=O)OC[C@H]1O[C@@H](n2c(-c3ccccc3)cc(-c3ccccc3)c(C#N)c2=O)[C@H](OC(C)=O)[C@@H](OC(C)=O)[C@@H]1OC(C)=O |
| InChI | InChI=1S/C32H30N2O10/c1-18(35)40-17-27-28(41-19(2)36)29(42-20(3)37)30(43-21(4)38)32(44-27)34-26(23-13-9-6-10-14-23)15-24(25(16-33)31(34)39)22-11-7-5-8-12-22/h5-15,27-30,32H,17H2,1-4H3/t27-,28-,29+,30-,32-/m1/s1 |
| InChIKey | HTWBZYRZYRIZQI-LTGXLJKXSA-N |
| XLogP | 3.31 |
| TPSA | 160.22 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 12 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 44 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 602.60 |
| LogP ≤ 5 | 3.31 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 12 |
| Structural Alerts | {'alert_name': '>_2_ester_groups', 'substructure': 'N/A'} |
|---|