C13H14N6O — CID 3006038
[(1S,2Z)-2-[[2-amino-6-(prop-2-ynylamino)purin-9-yl]methylidene]cyclopropyl]methanol (PubChem CID 3006038) has the molecular formula C13H14N6O and a molecular weight of 270.30 g/mol. Its IUPAC name is [(1S,2Z)-2-[[2-amino-6-(prop-2-ynylamino)purin-9-yl]methylidene]cyclopropyl]methanol.
| Compound Name | [(1S,2Z)-2-[[2-amino-6-(prop-2-ynylamino)purin-9-yl]methylidene]cyclopropyl]methanol |
|---|---|
| PubChem CID | 3006038 |
| Molecular Formula | C13H14N6O |
| Molecular Weight | 270.30 g/mol |
| Exact Mass | 270.12 |
| IUPAC Name | [(1S,2Z)-2-[[2-amino-6-(prop-2-ynylamino)purin-9-yl]methylidene]cyclopropyl]methanol |
| SMILES | C#CCNc1nc(N)nc2c1ncn2/C=C1/C[C@@H]1CO |
| InChI | InChI=1S/C13H14N6O/c1-2-3-15-11-10-12(18-13(14)17-11)19(7-16-10)5-8-4-9(8)6-20/h1,5,7,9,20H,3-4,6H2,(H3,14,15,17,18)/b8-5-/t9-/m1/s1 |
| InChIKey | RCWPTQJLPZIIAH-BZJXQOFCSA-N |
| XLogP | 0.31 |
| TPSA | 101.88 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 270.30 |
| LogP ≤ 5 | 0.31 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|