About [(1S,2Z)-2-[[2-amino-6-(cyclopropylmethoxy)purin-9-yl]methylidene]cyclopropyl]methanol
[(1S,2Z)-2-[[2-amino-6-(cyclopropylmethoxy)purin-9-yl]methylidene]cyclopropyl]methanol (PubChem CID 3006045) has the molecular formula C14H17N5O2
and a molecular weight of 287.32 g/mol. Its IUPAC name is [(1S,2Z)-2-[[2-amino-6-(cyclopropylmethoxy)purin-9-yl]methylidene]cyclopropyl]methanol.
Molecular Properties
| Compound Name | [(1S,2Z)-2-[[2-amino-6-(cyclopropylmethoxy)purin-9-yl]methylidene]cyclopropyl]methanol |
| PubChem CID | 3006045 |
| Molecular Formula | C14H17N5O2 |
| Molecular Weight | 287.32 g/mol |
| Exact Mass | 287.14 |
| IUPAC Name | [(1S,2Z)-2-[[2-amino-6-(cyclopropylmethoxy)purin-9-yl]methylidene]cyclopropyl]methanol |
| SMILES | Nc1nc(OCC2CC2)c2ncn(/C=C3/C[C@@H]3CO)c2n1 |
| InChI | InChI=1S/C14H17N5O2/c15-14-17-12-11(13(18-14)21-6-8-1-2-8)16-7-19(12)4-9-3-10(9)5-20/h4,7-8,10,20H,1-3,5-6H2,(H2,15,17,18)/b9-4-/t10-/m1/s1 |
| InChIKey | KGWBYJFWZNITGI-ZUYFITGHSA-N |
| XLogP | 1.05 |
| TPSA | 99.08 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 21 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 287.32 |
| LogP ≤ 5 | 1.05 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
Analyze [(1S,2Z)-2-[[2-amino-6-(cyclopropylmethoxy)purin-9-yl]methylidene]cyclopropyl]methanol with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of [(1S,2Z)-2-[[2-amino-6-(cyclopropylmethoxy)purin-9-yl]methylidene]cyclopropyl]methanol?
The IUPAC name of [(1S,2Z)-2-[[2-amino-6-(cyclopropylmethoxy)purin-9-yl]methylidene]cyclopropyl]methanol (CID 3006045) is [(1S,2Z)-2-[[2-amino-6-(cyclopropylmethoxy)purin-9-yl]methylidene]cyclopropyl]methanol.
What is the SMILES notation for [(1S,2Z)-2-[[2-amino-6-(cyclopropylmethoxy)purin-9-yl]methylidene]cyclopropyl]methanol?
The canonical SMILES for [(1S,2Z)-2-[[2-amino-6-(cyclopropylmethoxy)purin-9-yl]methylidene]cyclopropyl]methanol is Nc1nc(OCC2CC2)c2ncn(/C=C3/C[C@@H]3CO)c2n1.
What is the InChIKey of [(1S,2Z)-2-[[2-amino-6-(cyclopropylmethoxy)purin-9-yl]methylidene]cyclopropyl]methanol?
The InChIKey is KGWBYJFWZNITGI-ZUYFITGHSA-N. The full InChI is InChI=1S/C14H17N5O2/c15-14-17-12-11(13(18-14)21-6-8-1-2-8)16-7-19(12)4-9-3-10(9)5-20/h4,7-8,10,20H,1-3,5-6H2,(H2,15,17,18)/b9-4-/t10-/m1/s1.
What are the key properties of [(1S,2Z)-2-[[2-amino-6-(cyclopropylmethoxy)purin-9-yl]methylidene]cyclopropyl]methanol?
[(1S,2Z)-2-[[2-amino-6-(cyclopropylmethoxy)purin-9-yl]methylidene]cyclopropyl]methanol has a molecular weight of 287.32 g/mol, XLogP of 1.05, 5 rotatable bonds, 2 hydrogen bond donors, and 7 hydrogen bond acceptors.
Where does this data come from?
All data for [(1S,2Z)-2-[[2-amino-6-(cyclopropylmethoxy)purin-9-yl]methylidene]cyclopropyl]methanol is sourced from PubChem (CID 3006045), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).