About (1E)-N-[2-(2-ethylpiperidin-1-yl)ethyl]-2,6-dimethylhepta-1,5-dien-1-amine
(1E)-N-[2-(2-ethylpiperidin-1-yl)ethyl]-2,6-dimethylhepta-1,5-dien-1-amine (PubChem CID 3006131) has the molecular formula C18H34N2
and a molecular weight of 278.48 g/mol. Its IUPAC name is (1E)-N-[2-(2-ethylpiperidin-1-yl)ethyl]-2,6-dimethylhepta-1,5-dien-1-amine.
Molecular Properties
| Compound Name | (1E)-N-[2-(2-ethylpiperidin-1-yl)ethyl]-2,6-dimethylhepta-1,5-dien-1-amine |
| PubChem CID | 3006131 |
| Molecular Formula | C18H34N2 |
| Molecular Weight | 278.48 g/mol |
| Exact Mass | 278.27 |
| IUPAC Name | (1E)-N-[2-(2-ethylpiperidin-1-yl)ethyl]-2,6-dimethylhepta-1,5-dien-1-amine |
| SMILES | CCC1CCCCN1CCN/C=C(\C)CCC=C(C)C |
| InChI | InChI=1S/C18H34N2/c1-5-18-11-6-7-13-20(18)14-12-19-15-17(4)10-8-9-16(2)3/h9,15,18-19H,5-8,10-14H2,1-4H3/b17-15+ |
| InChIKey | AJLAGTRJGDZCPN-BMRADRMJSA-N |
| XLogP | 4.49 |
| TPSA | 15.27 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 20 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 278.48 |
| LogP ≤ 5 | 4.49 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|
Analyze (1E)-N-[2-(2-ethylpiperidin-1-yl)ethyl]-2,6-dimethylhepta-1,5-dien-1-amine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (1E)-N-[2-(2-ethylpiperidin-1-yl)ethyl]-2,6-dimethylhepta-1,5-dien-1-amine?
The IUPAC name of (1E)-N-[2-(2-ethylpiperidin-1-yl)ethyl]-2,6-dimethylhepta-1,5-dien-1-amine (CID 3006131) is (1E)-N-[2-(2-ethylpiperidin-1-yl)ethyl]-2,6-dimethylhepta-1,5-dien-1-amine.
What is the SMILES notation for (1E)-N-[2-(2-ethylpiperidin-1-yl)ethyl]-2,6-dimethylhepta-1,5-dien-1-amine?
The canonical SMILES for (1E)-N-[2-(2-ethylpiperidin-1-yl)ethyl]-2,6-dimethylhepta-1,5-dien-1-amine is CCC1CCCCN1CCN/C=C(\C)CCC=C(C)C.
What is the InChIKey of (1E)-N-[2-(2-ethylpiperidin-1-yl)ethyl]-2,6-dimethylhepta-1,5-dien-1-amine?
The InChIKey is AJLAGTRJGDZCPN-BMRADRMJSA-N. The full InChI is InChI=1S/C18H34N2/c1-5-18-11-6-7-13-20(18)14-12-19-15-17(4)10-8-9-16(2)3/h9,15,18-19H,5-8,10-14H2,1-4H3/b17-15+.
What are the key properties of (1E)-N-[2-(2-ethylpiperidin-1-yl)ethyl]-2,6-dimethylhepta-1,5-dien-1-amine?
(1E)-N-[2-(2-ethylpiperidin-1-yl)ethyl]-2,6-dimethylhepta-1,5-dien-1-amine has a molecular weight of 278.48 g/mol, XLogP of 4.49, 8 rotatable bonds, 1 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for (1E)-N-[2-(2-ethylpiperidin-1-yl)ethyl]-2,6-dimethylhepta-1,5-dien-1-amine is sourced from PubChem (CID 3006131), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).