C19H34N2 — CID 3006132
N'-cyclopentyl-N-[(1E)-2,6-dimethylhepta-1,5-dienyl]-N'-prop-2-enylethane-1,2-diamine (PubChem CID 3006132) has the molecular formula C19H34N2 and a molecular weight of 290.50 g/mol. Its IUPAC name is N'-cyclopentyl-N-[(1E)-2,6-dimethylhepta-1,5-dienyl]-N'-prop-2-enylethane-1,2-diamine.
| Compound Name | N'-cyclopentyl-N-[(1E)-2,6-dimethylhepta-1,5-dienyl]-N'-prop-2-enylethane-1,2-diamine |
|---|---|
| PubChem CID | 3006132 |
| Molecular Formula | C19H34N2 |
| Molecular Weight | 290.50 g/mol |
| Exact Mass | 290.27 |
| IUPAC Name | N'-cyclopentyl-N-[(1E)-2,6-dimethylhepta-1,5-dienyl]-N'-prop-2-enylethane-1,2-diamine |
| SMILES | C=CCN(CCN/C=C(\C)CCC=C(C)C)C1CCCC1 |
| InChI | InChI=1S/C19H34N2/c1-5-14-21(19-11-6-7-12-19)15-13-20-16-18(4)10-8-9-17(2)3/h5,9,16,19-20H,1,6-8,10-15H2,2-4H3/b18-16+ |
| InChIKey | FZZYIVQVAQIDML-FBMGVBCBSA-N |
| XLogP | 4.66 |
| TPSA | 15.27 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 290.50 |
| LogP ≤ 5 | 4.66 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|