About 4-azido-2-hydroxybenzoic acid
4-azido-2-hydroxybenzoic acid (PubChem CID 3006162) has the molecular formula C7H5N3O3
and a molecular weight of 179.14 g/mol. Its IUPAC name is 4-azido-2-hydroxybenzoic acid.
Molecular Properties
| Compound Name | 4-azido-2-hydroxybenzoic acid |
| PubChem CID | 3006162 |
| Molecular Formula | C7H5N3O3 |
| Molecular Weight | 179.14 g/mol |
| Exact Mass | 179.03 |
| IUPAC Name | 4-azido-2-hydroxybenzoic acid |
| SMILES | [N-]=[N+]=Nc1ccc(C(=O)O)c(O)c1 |
| InChI | InChI=1S/C7H5N3O3/c8-10-9-4-1-2-5(7(12)13)6(11)3-4/h1-3,11H,(H,12,13) |
| InChIKey | NLPWSMKACWGINL-UHFFFAOYSA-N |
| XLogP | 2.03 |
| TPSA | 106.29 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 13 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 179.14 |
| LogP ≤ 5 | 2.03 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'azo_A(324)', 'substructure': 'N/A'}, {'alert_name': 'Azido_group', 'substructure': 'N/A'}, {'alert_name': 'diazo_group', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_3', 'substructure': 'N/A'} |
|---|
Analyze 4-azido-2-hydroxybenzoic acid with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 4-azido-2-hydroxybenzoic acid?
The IUPAC name of 4-azido-2-hydroxybenzoic acid (CID 3006162) is 4-azido-2-hydroxybenzoic acid.
What is the SMILES notation for 4-azido-2-hydroxybenzoic acid?
The canonical SMILES for 4-azido-2-hydroxybenzoic acid is [N-]=[N+]=Nc1ccc(C(=O)O)c(O)c1.
What is the InChIKey of 4-azido-2-hydroxybenzoic acid?
The InChIKey is NLPWSMKACWGINL-UHFFFAOYSA-N. The full InChI is InChI=1S/C7H5N3O3/c8-10-9-4-1-2-5(7(12)13)6(11)3-4/h1-3,11H,(H,12,13).
What are the key properties of 4-azido-2-hydroxybenzoic acid?
4-azido-2-hydroxybenzoic acid has a molecular weight of 179.14 g/mol, XLogP of 2.03, 2 rotatable bonds, 2 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 4-azido-2-hydroxybenzoic acid is sourced from PubChem (CID 3006162), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).