About (3E)-3-[(1,3-benzothiazol-2-ylamino)methylidene]-2-ethoxy-6-methylchromen-4-one
(3E)-3-[(1,3-benzothiazol-2-ylamino)methylidene]-2-ethoxy-6-methylchromen-4-one (PubChem CID 3006215) has the molecular formula C20H18N2O3S
and a molecular weight of 366.44 g/mol. Its IUPAC name is (3E)-3-[(1,3-benzothiazol-2-ylamino)methylidene]-2-ethoxy-6-methylchromen-4-one.
Molecular Properties
| Compound Name | (3E)-3-[(1,3-benzothiazol-2-ylamino)methylidene]-2-ethoxy-6-methylchromen-4-one |
| PubChem CID | 3006215 |
| Molecular Formula | C20H18N2O3S |
| Molecular Weight | 366.44 g/mol |
| Exact Mass | 366.10 |
| IUPAC Name | (3E)-3-[(1,3-benzothiazol-2-ylamino)methylidene]-2-ethoxy-6-methylchromen-4-one |
| SMILES | CCOC1Oc2ccc(C)cc2C(=O)/C1=C/Nc1nc2ccccc2s1 |
| InChI | InChI=1S/C20H18N2O3S/c1-3-24-19-14(18(23)13-10-12(2)8-9-16(13)25-19)11-21-20-22-15-6-4-5-7-17(15)26-20/h4-11,19H,3H2,1-2H3,(H,21,22)/b14-11- |
| InChIKey | SUGHYZAZXKUNLF-KAMYIIQDSA-N |
| XLogP | 4.54 |
| TPSA | 60.45 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 26 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 366.44 |
| LogP ≤ 5 | 4.54 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|
Analyze (3E)-3-[(1,3-benzothiazol-2-ylamino)methylidene]-2-ethoxy-6-methylchromen-4-one with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (3E)-3-[(1,3-benzothiazol-2-ylamino)methylidene]-2-ethoxy-6-methylchromen-4-one?
The IUPAC name of (3E)-3-[(1,3-benzothiazol-2-ylamino)methylidene]-2-ethoxy-6-methylchromen-4-one (CID 3006215) is (3E)-3-[(1,3-benzothiazol-2-ylamino)methylidene]-2-ethoxy-6-methylchromen-4-one.
What is the SMILES notation for (3E)-3-[(1,3-benzothiazol-2-ylamino)methylidene]-2-ethoxy-6-methylchromen-4-one?
The canonical SMILES for (3E)-3-[(1,3-benzothiazol-2-ylamino)methylidene]-2-ethoxy-6-methylchromen-4-one is CCOC1Oc2ccc(C)cc2C(=O)/C1=C/Nc1nc2ccccc2s1.
What is the InChIKey of (3E)-3-[(1,3-benzothiazol-2-ylamino)methylidene]-2-ethoxy-6-methylchromen-4-one?
The InChIKey is SUGHYZAZXKUNLF-KAMYIIQDSA-N. The full InChI is InChI=1S/C20H18N2O3S/c1-3-24-19-14(18(23)13-10-12(2)8-9-16(13)25-19)11-21-20-22-15-6-4-5-7-17(15)26-20/h4-11,19H,3H2,1-2H3,(H,21,22)/b14-11-.
What are the key properties of (3E)-3-[(1,3-benzothiazol-2-ylamino)methylidene]-2-ethoxy-6-methylchromen-4-one?
(3E)-3-[(1,3-benzothiazol-2-ylamino)methylidene]-2-ethoxy-6-methylchromen-4-one has a molecular weight of 366.44 g/mol, XLogP of 4.54, 4 rotatable bonds, 1 hydrogen bond donors, and 6 hydrogen bond acceptors.
Where does this data come from?
All data for (3E)-3-[(1,3-benzothiazol-2-ylamino)methylidene]-2-ethoxy-6-methylchromen-4-one is sourced from PubChem (CID 3006215), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).