About 1,4-bis[4-(1,3-dimethylimidazolidin-2-yl)phenyl]piperazine
1,4-bis[4-(1,3-dimethylimidazolidin-2-yl)phenyl]piperazine (PubChem CID 3006252) has the molecular formula C26H38N6
and a molecular weight of 434.63 g/mol. Its IUPAC name is 1,4-bis[4-(1,3-dimethylimidazolidin-2-yl)phenyl]piperazine.
Molecular Properties
| Compound Name | 1,4-bis[4-(1,3-dimethylimidazolidin-2-yl)phenyl]piperazine |
| PubChem CID | 3006252 |
| Molecular Formula | C26H38N6 |
| Molecular Weight | 434.63 g/mol |
| Exact Mass | 434.32 |
| IUPAC Name | 1,4-bis[4-(1,3-dimethylimidazolidin-2-yl)phenyl]piperazine |
| SMILES | CN1CCN(C)C1c1ccc(N2CCN(c3ccc(C4N(C)CCN4C)cc3)CC2)cc1 |
| InChI | InChI=1S/C26H38N6/c1-27-13-14-28(2)25(27)21-5-9-23(10-6-21)31-17-19-32(20-18-31)24-11-7-22(8-12-24)26-29(3)15-16-30(26)4/h5-12,25-26H,13-20H2,1-4H3 |
| InChIKey | IDRQWHHJOQTROJ-UHFFFAOYSA-N |
| XLogP | 2.76 |
| TPSA | 19.44 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 32 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 434.63 |
| LogP ≤ 5 | 2.76 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'anil_di_alk_D(198)', 'substructure': 'N/A'} |
|---|
Analyze 1,4-bis[4-(1,3-dimethylimidazolidin-2-yl)phenyl]piperazine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1,4-bis[4-(1,3-dimethylimidazolidin-2-yl)phenyl]piperazine?
The IUPAC name of 1,4-bis[4-(1,3-dimethylimidazolidin-2-yl)phenyl]piperazine (CID 3006252) is 1,4-bis[4-(1,3-dimethylimidazolidin-2-yl)phenyl]piperazine.
What is the SMILES notation for 1,4-bis[4-(1,3-dimethylimidazolidin-2-yl)phenyl]piperazine?
The canonical SMILES for 1,4-bis[4-(1,3-dimethylimidazolidin-2-yl)phenyl]piperazine is CN1CCN(C)C1c1ccc(N2CCN(c3ccc(C4N(C)CCN4C)cc3)CC2)cc1.
What is the InChIKey of 1,4-bis[4-(1,3-dimethylimidazolidin-2-yl)phenyl]piperazine?
The InChIKey is IDRQWHHJOQTROJ-UHFFFAOYSA-N. The full InChI is InChI=1S/C26H38N6/c1-27-13-14-28(2)25(27)21-5-9-23(10-6-21)31-17-19-32(20-18-31)24-11-7-22(8-12-24)26-29(3)15-16-30(26)4/h5-12,25-26H,13-20H2,1-4H3.
What are the key properties of 1,4-bis[4-(1,3-dimethylimidazolidin-2-yl)phenyl]piperazine?
1,4-bis[4-(1,3-dimethylimidazolidin-2-yl)phenyl]piperazine has a molecular weight of 434.63 g/mol, XLogP of 2.76, 4 rotatable bonds, 0 hydrogen bond donors, and 6 hydrogen bond acceptors.
Where does this data come from?
All data for 1,4-bis[4-(1,3-dimethylimidazolidin-2-yl)phenyl]piperazine is sourced from PubChem (CID 3006252), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).