C24H30N6 — CID 3006261
2-[4-[4-[4-(1,4,5,6-tetrahydropyrimidin-2-yl)phenyl]piperazin-1-yl]phenyl]-1,4,5,6-tetrahydropyrimidine (PubChem CID 3006261) has the molecular formula C24H30N6 and a molecular weight of 402.55 g/mol. Its IUPAC name is 2-[4-[4-[4-(1,4,5,6-tetrahydropyrimidin-2-yl)phenyl]piperazin-1-yl]phenyl]-1,4,5,6-tetrahydropyrimidine.
| Compound Name | 2-[4-[4-[4-(1,4,5,6-tetrahydropyrimidin-2-yl)phenyl]piperazin-1-yl]phenyl]-1,4,5,6-tetrahydropyrimidine |
|---|---|
| PubChem CID | 3006261 |
| Molecular Formula | C24H30N6 |
| Molecular Weight | 402.55 g/mol |
| Exact Mass | 402.25 |
| IUPAC Name | 2-[4-[4-[4-(1,4,5,6-tetrahydropyrimidin-2-yl)phenyl]piperazin-1-yl]phenyl]-1,4,5,6-tetrahydropyrimidine |
| SMILES | c1cc(N2CCN(c3ccc(C4=NCCCN4)cc3)CC2)ccc1C1=NCCCN1 |
| InChI | InChI=1S/C24H30N6/c1-11-25-23(26-12-1)19-3-7-21(8-4-19)29-15-17-30(18-16-29)22-9-5-20(6-10-22)24-27-13-2-14-28-24/h3-10H,1-2,11-18H2,(H,25,26)(H,27,28) |
| InChIKey | ZWEXWKWRQUJAHI-UHFFFAOYSA-N |
| XLogP | 2.49 |
| TPSA | 55.26 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 402.55 |
| LogP ≤ 5 | 2.49 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |