C24H30Cl2N4O2S — CID 3006339
(2S)-N-[[1-[(3,4-dichlorophenyl)methyl]piperidin-4-yl]methyl]-2-[(3-methoxyphenyl)carbamothioylamino]propanamide (PubChem CID 3006339) has the molecular formula C24H30Cl2N4O2S and a molecular weight of 509.50 g/mol. Its IUPAC name is (2S)-N-[[1-[(3,4-dichlorophenyl)methyl]piperidin-4-yl]methyl]-2-[(3-methoxyphenyl)carbamothioylamino]propanamide.
| Compound Name | (2S)-N-[[1-[(3,4-dichlorophenyl)methyl]piperidin-4-yl]methyl]-2-[(3-methoxyphenyl)carbamothioylamino]propanamide |
|---|---|
| PubChem CID | 3006339 |
| Molecular Formula | C24H30Cl2N4O2S |
| Molecular Weight | 509.50 g/mol |
| Exact Mass | 508.15 |
| IUPAC Name | (2S)-N-[[1-[(3,4-dichlorophenyl)methyl]piperidin-4-yl]methyl]-2-[(3-methoxyphenyl)carbamothioylamino]propanamide |
| SMILES | COc1cccc(NC(=S)N[C@@H](C)C(=O)NCC2CCN(Cc3ccc(Cl)c(Cl)c3)CC2)c1 |
| InChI | InChI=1S/C24H30Cl2N4O2S/c1-16(28-24(33)29-19-4-3-5-20(13-19)32-2)23(31)27-14-17-8-10-30(11-9-17)15-18-6-7-21(25)22(26)12-18/h3-7,12-13,16-17H,8-11,14-15H2,1-2H3,(H,27,31)(H2,28,29,33)/t16-/m0/s1 |
| InChIKey | IYUHXGXZRBTELQ-INIZCTEOSA-N |
| XLogP | 4.71 |
| TPSA | 65.63 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 33 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 509.50 |
| LogP ≤ 5 | 4.71 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|