C10H15BrO — CID 3006542
(1R,3S,4R)-3-bromo-1,7,7-trimethylbicyclo[2.2.1]heptan-2-one (PubChem CID 3006542) has the molecular formula C10H15BrO and a molecular weight of 231.13 g/mol. Its IUPAC name is (1R,3S,4R)-3-bromo-1,7,7-trimethylbicyclo[2.2.1]heptan-2-one.
| Compound Name | (1R,3S,4R)-3-bromo-1,7,7-trimethylbicyclo[2.2.1]heptan-2-one |
|---|---|
| PubChem CID | 3006542 |
| Molecular Formula | C10H15BrO |
| Molecular Weight | 231.13 g/mol |
| Exact Mass | 230.03 |
| IUPAC Name | (1R,3S,4R)-3-bromo-1,7,7-trimethylbicyclo[2.2.1]heptan-2-one |
| SMILES | CC1(C)[C@H]2CC[C@@]1(C)C(=O)[C@H]2Br |
| InChI | InChI=1S/C10H15BrO/c1-9(2)6-4-5-10(9,3)8(12)7(6)11/h6-7H,4-5H2,1-3H3/t6-,7-,10-/m0/s1 |
| InChIKey | NJQADTYRAYFBJN-BYULHYEWSA-N |
| XLogP | 2.78 |
| TPSA | 17.07 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | |
| Heavy Atoms | 12 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 231.13 |
| LogP ≤ 5 | 2.78 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|