C14H17N3O8S — CID 3006617
[(2R,5R)-3,4-diacetyloxy-5-(3-oxo-5-sulfanylidene-1,2,4-triazin-2-yl)oxolan-2-yl]methyl acetate (PubChem CID 3006617) has the molecular formula C14H17N3O8S and a molecular weight of 387.37 g/mol. Its IUPAC name is [(2R,5R)-3,4-diacetyloxy-5-(3-oxo-5-sulfanylidene-1,2,4-triazin-2-yl)oxolan-2-yl]methyl acetate.
| Compound Name | [(2R,5R)-3,4-diacetyloxy-5-(3-oxo-5-sulfanylidene-1,2,4-triazin-2-yl)oxolan-2-yl]methyl acetate |
|---|---|
| PubChem CID | 3006617 |
| Molecular Formula | C14H17N3O8S |
| Molecular Weight | 387.37 g/mol |
| Exact Mass | 387.07 |
| IUPAC Name | [(2R,5R)-3,4-diacetyloxy-5-(3-oxo-5-sulfanylidene-1,2,4-triazin-2-yl)oxolan-2-yl]methyl acetate |
| SMILES | CC(=O)OC[C@H]1O[C@@H](n2ncc(=S)[nH]c2=O)C(OC(C)=O)C1OC(C)=O |
| InChI | InChI=1S/C14H17N3O8S/c1-6(18)22-5-9-11(23-7(2)19)12(24-8(3)20)13(25-9)17-14(21)16-10(26)4-15-17/h4,9,11-13H,5H2,1-3H3,(H,16,21,26)/t9-,11?,12?,13-/m1/s1 |
| InChIKey | PZKMCJFYHILVJG-SARFZWSYSA-N |
| XLogP | -0.38 |
| TPSA | 138.81 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 11 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 26 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 387.37 |
| LogP ≤ 5 | -0.38 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 11 |
| Structural Alerts | {'alert_name': '>_2_ester_groups', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|