C35H48N4O7S2 — CID 3006633
3-[(5S)-5-[(4-aminophenyl)sulfonyl-(3-methylbutyl)amino]-6-hydroxyhexyl]-1-(1,3-benzodioxol-5-ylmethyl)-1-[(3,4-dimethoxyphenyl)methyl]thiourea (PubChem CID 3006633) has the molecular formula C35H48N4O7S2 and a molecular weight of 700.92 g/mol. Its IUPAC name is 3-[(5S)-5-[(4-aminophenyl)sulfonyl-(3-methylbutyl)amino]-6-hydroxyhexyl]-1-(1,3-benzodioxol-5-ylmethyl)-1-[(3,4-dimethoxyphenyl)methyl]thiourea.
| Compound Name | 3-[(5S)-5-[(4-aminophenyl)sulfonyl-(3-methylbutyl)amino]-6-hydroxyhexyl]-1-(1,3-benzodioxol-5-ylmethyl)-1-[(3,4-dimethoxyphenyl)methyl]thiourea |
|---|---|
| PubChem CID | 3006633 |
| Molecular Formula | C35H48N4O7S2 |
| Molecular Weight | 700.92 g/mol |
| Exact Mass | 700.30 |
| IUPAC Name | 3-[(5S)-5-[(4-aminophenyl)sulfonyl-(3-methylbutyl)amino]-6-hydroxyhexyl]-1-(1,3-benzodioxol-5-ylmethyl)-1-[(3,4-dimethoxyphenyl)methyl]thiourea |
| SMILES | COc1ccc(CN(Cc2ccc3c(c2)OCO3)C(=S)NCCCC[C@@H](CO)N(CCC(C)C)S(=O)(=O)c2ccc(N)cc2)cc1OC |
| InChI | InChI=1S/C35H48N4O7S2/c1-25(2)16-18-39(48(41,42)30-12-10-28(36)11-13-30)29(23-40)7-5-6-17-37-35(47)38(21-26-8-14-31(43-3)33(19-26)44-4)22-27-9-15-32-34(20-27)46-24-45-32/h8-15,19-20,25,29,40H,5-7,16-18,21-24,36H2,1-4H3,(H,37,47)/t29-/m0/s1 |
| InChIKey | UIJTVLDYMXSMIP-LJAQVGFWSA-N |
| XLogP | 5.16 |
| TPSA | 135.82 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 18 |
| Heavy Atoms | 48 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 700.92 |
| LogP ≤ 5 | 5.16 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'aniline', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|