C34H46N4O6S2 — CID 3006636
3-[(5S)-5-[(4-aminophenyl)sulfonyl-(3-methylbutyl)amino]-6-hydroxyhexyl]-1-(1,3-benzodioxol-5-ylmethyl)-1-[(4-methoxyphenyl)methyl]thiourea (PubChem CID 3006636) has the molecular formula C34H46N4O6S2 and a molecular weight of 670.90 g/mol. Its IUPAC name is 3-[(5S)-5-[(4-aminophenyl)sulfonyl-(3-methylbutyl)amino]-6-hydroxyhexyl]-1-(1,3-benzodioxol-5-ylmethyl)-1-[(4-methoxyphenyl)methyl]thiourea.
| Compound Name | 3-[(5S)-5-[(4-aminophenyl)sulfonyl-(3-methylbutyl)amino]-6-hydroxyhexyl]-1-(1,3-benzodioxol-5-ylmethyl)-1-[(4-methoxyphenyl)methyl]thiourea |
|---|---|
| PubChem CID | 3006636 |
| Molecular Formula | C34H46N4O6S2 |
| Molecular Weight | 670.90 g/mol |
| Exact Mass | 670.29 |
| IUPAC Name | 3-[(5S)-5-[(4-aminophenyl)sulfonyl-(3-methylbutyl)amino]-6-hydroxyhexyl]-1-(1,3-benzodioxol-5-ylmethyl)-1-[(4-methoxyphenyl)methyl]thiourea |
| SMILES | COc1ccc(CN(Cc2ccc3c(c2)OCO3)C(=S)NCCCC[C@@H](CO)N(CCC(C)C)S(=O)(=O)c2ccc(N)cc2)cc1 |
| InChI | InChI=1S/C34H46N4O6S2/c1-25(2)17-19-38(46(40,41)31-14-10-28(35)11-15-31)29(23-39)6-4-5-18-36-34(45)37(21-26-7-12-30(42-3)13-8-26)22-27-9-16-32-33(20-27)44-24-43-32/h7-16,20,25,29,39H,4-6,17-19,21-24,35H2,1-3H3,(H,36,45)/t29-/m0/s1 |
| InChIKey | SPDFGCYXBCIFOC-LJAQVGFWSA-N |
| XLogP | 5.15 |
| TPSA | 126.59 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 17 |
| Heavy Atoms | 46 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 670.90 |
| LogP ≤ 5 | 5.15 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'aniline', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|