C18H21N2O3S2- — CID 3006703
3,3-dimethyl-7-methylidene-6-(2-phenoxypropanoylamino)-4-thia-1-azabicyclo[3.2.0]heptane-2-carbothioate (PubChem CID 3006703) has the molecular formula C18H21N2O3S2- and a molecular weight of 377.51 g/mol. Its IUPAC name is 3,3-dimethyl-7-methylidene-6-(2-phenoxypropanoylamino)-4-thia-1-azabicyclo[3.2.0]heptane-2-carbothioate.
| Compound Name | 3,3-dimethyl-7-methylidene-6-(2-phenoxypropanoylamino)-4-thia-1-azabicyclo[3.2.0]heptane-2-carbothioate |
|---|---|
| PubChem CID | 3006703 |
| Molecular Formula | C18H21N2O3S2- |
| Molecular Weight | 377.51 g/mol |
| Exact Mass | 377.10 |
| IUPAC Name | 3,3-dimethyl-7-methylidene-6-(2-phenoxypropanoylamino)-4-thia-1-azabicyclo[3.2.0]heptane-2-carbothioate |
| SMILES | C=C1C(NC(=O)C(C)Oc2ccccc2)C2SC(C)(C)C(C(=O)[S-])N12 |
| InChI | InChI=1S/C18H22N2O3S2/c1-10-13(16-20(10)14(17(22)24)18(3,4)25-16)19-15(21)11(2)23-12-8-6-5-7-9-12/h5-9,11,13-14,16H,1H2,2-4H3,(H,19,21)(H,22,24)/p-1 |
| InChIKey | ARWQWGMZAGBUHZ-UHFFFAOYSA-M |
| XLogP | 2.06 |
| TPSA | 58.64 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 377.51 |
| LogP ≤ 5 | 2.06 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'thioester', 'substructure': 'N/A'}, {'alert_name': 'thiol_1', 'substructure': 'N/A'} |
|---|