About 2-(furan-2-yl)-2,3-dihydro-1,3-benzothiazole
2-(furan-2-yl)-2,3-dihydro-1,3-benzothiazole (PubChem CID 3006716) has the molecular formula C11H9NOS
and a molecular weight of 203.27 g/mol. Its IUPAC name is 2-(furan-2-yl)-2,3-dihydro-1,3-benzothiazole.
Molecular Properties
| Compound Name | 2-(furan-2-yl)-2,3-dihydro-1,3-benzothiazole |
| PubChem CID | 3006716 |
| Molecular Formula | C11H9NOS |
| Molecular Weight | 203.27 g/mol |
| Exact Mass | 203.04 |
| IUPAC Name | 2-(furan-2-yl)-2,3-dihydro-1,3-benzothiazole |
| SMILES | c1coc(C2Nc3ccccc3S2)c1 |
| InChI | InChI=1S/C11H9NOS/c1-2-6-10-8(4-1)12-11(14-10)9-5-3-7-13-9/h1-7,11-12H |
| InChIKey | HRGDJJAIIYBMSY-UHFFFAOYSA-N |
| XLogP | 3.50 |
| TPSA | 25.17 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 14 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 203.27 |
| LogP ≤ 5 | 3.50 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze 2-(furan-2-yl)-2,3-dihydro-1,3-benzothiazole with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-(furan-2-yl)-2,3-dihydro-1,3-benzothiazole?
The IUPAC name of 2-(furan-2-yl)-2,3-dihydro-1,3-benzothiazole (CID 3006716) is 2-(furan-2-yl)-2,3-dihydro-1,3-benzothiazole.
What is the SMILES notation for 2-(furan-2-yl)-2,3-dihydro-1,3-benzothiazole?
The canonical SMILES for 2-(furan-2-yl)-2,3-dihydro-1,3-benzothiazole is c1coc(C2Nc3ccccc3S2)c1.
What is the InChIKey of 2-(furan-2-yl)-2,3-dihydro-1,3-benzothiazole?
The InChIKey is HRGDJJAIIYBMSY-UHFFFAOYSA-N. The full InChI is InChI=1S/C11H9NOS/c1-2-6-10-8(4-1)12-11(14-10)9-5-3-7-13-9/h1-7,11-12H.
What are the key properties of 2-(furan-2-yl)-2,3-dihydro-1,3-benzothiazole?
2-(furan-2-yl)-2,3-dihydro-1,3-benzothiazole has a molecular weight of 203.27 g/mol, XLogP of 3.50, 1 rotatable bonds, 1 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 2-(furan-2-yl)-2,3-dihydro-1,3-benzothiazole is sourced from PubChem (CID 3006716), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).