About 1-[1-(4-bromo-3-methyl-1,2-thiazol-5-yl)ethylideneamino]-3-methylthiourea
1-[1-(4-bromo-3-methyl-1,2-thiazol-5-yl)ethylideneamino]-3-methylthiourea (PubChem CID 3007054) has the molecular formula C8H11BrN4S2
and a molecular weight of 307.24 g/mol. Its IUPAC name is 1-[1-(4-bromo-3-methyl-1,2-thiazol-5-yl)ethylideneamino]-3-methylthiourea.
Molecular Properties
| Compound Name | 1-[1-(4-bromo-3-methyl-1,2-thiazol-5-yl)ethylideneamino]-3-methylthiourea |
| PubChem CID | 3007054 |
| Molecular Formula | C8H11BrN4S2 |
| Molecular Weight | 307.24 g/mol |
| Exact Mass | 305.96 |
| IUPAC Name | 1-[1-(4-bromo-3-methyl-1,2-thiazol-5-yl)ethylideneamino]-3-methylthiourea |
| SMILES | CNC(=S)NN=C(C)c1snc(C)c1Br |
| InChI | InChI=1S/C8H11BrN4S2/c1-4-6(9)7(15-13-4)5(2)11-12-8(14)10-3/h1-3H3,(H2,10,12,14) |
| InChIKey | GKVVEJDSSBODQG-UHFFFAOYSA-N |
| XLogP | 2.03 |
| TPSA | 49.31 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 15 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 307.24 |
| LogP ≤ 5 | 2.03 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|
Analyze 1-[1-(4-bromo-3-methyl-1,2-thiazol-5-yl)ethylideneamino]-3-methylthiourea with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1-[1-(4-bromo-3-methyl-1,2-thiazol-5-yl)ethylideneamino]-3-methylthiourea?
The IUPAC name of 1-[1-(4-bromo-3-methyl-1,2-thiazol-5-yl)ethylideneamino]-3-methylthiourea (CID 3007054) is 1-[1-(4-bromo-3-methyl-1,2-thiazol-5-yl)ethylideneamino]-3-methylthiourea.
What is the SMILES notation for 1-[1-(4-bromo-3-methyl-1,2-thiazol-5-yl)ethylideneamino]-3-methylthiourea?
The canonical SMILES for 1-[1-(4-bromo-3-methyl-1,2-thiazol-5-yl)ethylideneamino]-3-methylthiourea is CNC(=S)NN=C(C)c1snc(C)c1Br.
What is the InChIKey of 1-[1-(4-bromo-3-methyl-1,2-thiazol-5-yl)ethylideneamino]-3-methylthiourea?
The InChIKey is GKVVEJDSSBODQG-UHFFFAOYSA-N. The full InChI is InChI=1S/C8H11BrN4S2/c1-4-6(9)7(15-13-4)5(2)11-12-8(14)10-3/h1-3H3,(H2,10,12,14).
What are the key properties of 1-[1-(4-bromo-3-methyl-1,2-thiazol-5-yl)ethylideneamino]-3-methylthiourea?
1-[1-(4-bromo-3-methyl-1,2-thiazol-5-yl)ethylideneamino]-3-methylthiourea has a molecular weight of 307.24 g/mol, XLogP of 2.03, 2 rotatable bonds, 2 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 1-[1-(4-bromo-3-methyl-1,2-thiazol-5-yl)ethylideneamino]-3-methylthiourea is sourced from PubChem (CID 3007054), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).