About 4-(3-hexylsulfanyl-1H-1,2,4-triazol-5-yl)pyridine
4-(3-hexylsulfanyl-1H-1,2,4-triazol-5-yl)pyridine (PubChem CID 3007105) has the molecular formula C13H18N4S
and a molecular weight of 262.38 g/mol. Its IUPAC name is 4-(3-hexylsulfanyl-1H-1,2,4-triazol-5-yl)pyridine.
Molecular Properties
| Compound Name | 4-(3-hexylsulfanyl-1H-1,2,4-triazol-5-yl)pyridine |
| PubChem CID | 3007105 |
| Molecular Formula | C13H18N4S |
| Molecular Weight | 262.38 g/mol |
| Exact Mass | 262.13 |
| IUPAC Name | 4-(3-hexylsulfanyl-1H-1,2,4-triazol-5-yl)pyridine |
| SMILES | CCCCCCSc1n[nH]c(-c2ccncc2)n1 |
| InChI | InChI=1S/C13H18N4S/c1-2-3-4-5-10-18-13-15-12(16-17-13)11-6-8-14-9-7-11/h6-9H,2-5,10H2,1H3,(H,15,16,17) |
| InChIKey | VGRRFFCJLYKVGM-UHFFFAOYSA-N |
| XLogP | 3.54 |
| TPSA | 54.46 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 18 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 262.38 |
| LogP ≤ 5 | 3.54 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|
Analyze 4-(3-hexylsulfanyl-1H-1,2,4-triazol-5-yl)pyridine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 4-(3-hexylsulfanyl-1H-1,2,4-triazol-5-yl)pyridine?
The IUPAC name of 4-(3-hexylsulfanyl-1H-1,2,4-triazol-5-yl)pyridine (CID 3007105) is 4-(3-hexylsulfanyl-1H-1,2,4-triazol-5-yl)pyridine.
What is the SMILES notation for 4-(3-hexylsulfanyl-1H-1,2,4-triazol-5-yl)pyridine?
The canonical SMILES for 4-(3-hexylsulfanyl-1H-1,2,4-triazol-5-yl)pyridine is CCCCCCSc1n[nH]c(-c2ccncc2)n1.
What is the InChIKey of 4-(3-hexylsulfanyl-1H-1,2,4-triazol-5-yl)pyridine?
The InChIKey is VGRRFFCJLYKVGM-UHFFFAOYSA-N. The full InChI is InChI=1S/C13H18N4S/c1-2-3-4-5-10-18-13-15-12(16-17-13)11-6-8-14-9-7-11/h6-9H,2-5,10H2,1H3,(H,15,16,17).
What are the key properties of 4-(3-hexylsulfanyl-1H-1,2,4-triazol-5-yl)pyridine?
4-(3-hexylsulfanyl-1H-1,2,4-triazol-5-yl)pyridine has a molecular weight of 262.38 g/mol, XLogP of 3.54, 7 rotatable bonds, 1 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 4-(3-hexylsulfanyl-1H-1,2,4-triazol-5-yl)pyridine is sourced from PubChem (CID 3007105), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).