About 2-amino-9-hexyl-3,7-dihydropurine-6,8-dithione
2-amino-9-hexyl-3,7-dihydropurine-6,8-dithione (PubChem CID 3007369) has the molecular formula C11H17N5S2
and a molecular weight of 283.43 g/mol. Its IUPAC name is 2-amino-9-hexyl-3,7-dihydropurine-6,8-dithione.
Molecular Properties
| Compound Name | 2-amino-9-hexyl-3,7-dihydropurine-6,8-dithione |
| PubChem CID | 3007369 |
| Molecular Formula | C11H17N5S2 |
| Molecular Weight | 283.43 g/mol |
| Exact Mass | 283.09 |
| IUPAC Name | 2-amino-9-hexyl-3,7-dihydropurine-6,8-dithione |
| SMILES | CCCCCCn1c(=S)[nH]c2c(=S)nc(N)[nH]c21 |
| InChI | InChI=1S/C11H17N5S2/c1-2-3-4-5-6-16-8-7(13-11(16)18)9(17)15-10(12)14-8/h2-6H2,1H3,(H,13,18)(H3,12,14,15,17) |
| InChIKey | MNEGZUAAMQJKBN-UHFFFAOYSA-N |
| XLogP | 3.31 |
| TPSA | 75.42 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 18 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 283.43 |
| LogP ≤ 5 | 3.31 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|
Analyze 2-amino-9-hexyl-3,7-dihydropurine-6,8-dithione with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-amino-9-hexyl-3,7-dihydropurine-6,8-dithione?
The IUPAC name of 2-amino-9-hexyl-3,7-dihydropurine-6,8-dithione (CID 3007369) is 2-amino-9-hexyl-3,7-dihydropurine-6,8-dithione.
What is the SMILES notation for 2-amino-9-hexyl-3,7-dihydropurine-6,8-dithione?
The canonical SMILES for 2-amino-9-hexyl-3,7-dihydropurine-6,8-dithione is CCCCCCn1c(=S)[nH]c2c(=S)nc(N)[nH]c21.
What is the InChIKey of 2-amino-9-hexyl-3,7-dihydropurine-6,8-dithione?
The InChIKey is MNEGZUAAMQJKBN-UHFFFAOYSA-N. The full InChI is InChI=1S/C11H17N5S2/c1-2-3-4-5-6-16-8-7(13-11(16)18)9(17)15-10(12)14-8/h2-6H2,1H3,(H,13,18)(H3,12,14,15,17).
What are the key properties of 2-amino-9-hexyl-3,7-dihydropurine-6,8-dithione?
2-amino-9-hexyl-3,7-dihydropurine-6,8-dithione has a molecular weight of 283.43 g/mol, XLogP of 3.31, 5 rotatable bonds, 3 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for 2-amino-9-hexyl-3,7-dihydropurine-6,8-dithione is sourced from PubChem (CID 3007369), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).