C15H24N2O3 — CID 30074322
(1S,6R)-6-(4-propylpiperazine-1-carbonyl)cyclohex-3-ene-1-carboxylic acid (PubChem CID 30074322) has the molecular formula C15H24N2O3 and a molecular weight of 280.37 g/mol. Its IUPAC name is (1S,6R)-6-(4-propylpiperazine-1-carbonyl)cyclohex-3-ene-1-carboxylic acid.
| Compound Name | (1S,6R)-6-(4-propylpiperazine-1-carbonyl)cyclohex-3-ene-1-carboxylic acid |
|---|---|
| PubChem CID | 30074322 |
| Molecular Formula | C15H24N2O3 |
| Molecular Weight | 280.37 g/mol |
| Exact Mass | 280.18 |
| IUPAC Name | (1S,6R)-6-(4-propylpiperazine-1-carbonyl)cyclohex-3-ene-1-carboxylic acid |
| SMILES | CCCN1CCN(C(=O)[C@@H]2CC=CC[C@@H]2C(=O)O)CC1 |
| InChI | InChI=1S/C15H24N2O3/c1-2-7-16-8-10-17(11-9-16)14(18)12-5-3-4-6-13(12)15(19)20/h3-4,12-13H,2,5-11H2,1H3,(H,19,20)/t12-,13+/m1/s1 |
| InChIKey | ZORPCRXVCCHBGP-OLZOCXBDSA-N |
| XLogP | 1.21 |
| TPSA | 60.85 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 280.37 |
| LogP ≤ 5 | 1.21 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|