C18H12Cl2FN3O2S — CID 3007676
(4S,5R)-4-(2,4-dichlorophenyl)-5-(4-fluorophenyl)-4-(1,2,4-triazol-1-ylmethyl)-1,3-dioxolane-2-thione (PubChem CID 3007676) has the molecular formula C18H12Cl2FN3O2S and a molecular weight of 424.28 g/mol. Its IUPAC name is (4S,5R)-4-(2,4-dichlorophenyl)-5-(4-fluorophenyl)-4-(1,2,4-triazol-1-ylmethyl)-1,3-dioxolane-2-thione.
| Compound Name | (4S,5R)-4-(2,4-dichlorophenyl)-5-(4-fluorophenyl)-4-(1,2,4-triazol-1-ylmethyl)-1,3-dioxolane-2-thione |
|---|---|
| PubChem CID | 3007676 |
| Molecular Formula | C18H12Cl2FN3O2S |
| Molecular Weight | 424.28 g/mol |
| Exact Mass | 423.00 |
| IUPAC Name | (4S,5R)-4-(2,4-dichlorophenyl)-5-(4-fluorophenyl)-4-(1,2,4-triazol-1-ylmethyl)-1,3-dioxolane-2-thione |
| SMILES | Fc1ccc([C@H]2OC(=S)O[C@]2(Cn2cncn2)c2ccc(Cl)cc2Cl)cc1 |
| InChI | InChI=1S/C18H12Cl2FN3O2S/c19-12-3-6-14(15(20)7-12)18(8-24-10-22-9-23-24)16(25-17(27)26-18)11-1-4-13(21)5-2-11/h1-7,9-10,16H,8H2/t16-,18-/m1/s1 |
| InChIKey | ZUPCMHBLKUSDDE-SJLPKXTDSA-N |
| XLogP | 4.69 |
| TPSA | 49.17 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 424.28 |
| LogP ≤ 5 | 4.69 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|