C19H17N3O5 — CID 3007720
1',3',3'-trimethyl-5',6-dinitrospiro[chromene-2,2'-indole] (PubChem CID 3007720) has the molecular formula C19H17N3O5 and a molecular weight of 367.36 g/mol. Its IUPAC name is 1',3',3'-trimethyl-5',6-dinitrospiro[chromene-2,2'-indole].
| Compound Name | 1',3',3'-trimethyl-5',6-dinitrospiro[chromene-2,2'-indole] |
|---|---|
| PubChem CID | 3007720 |
| Molecular Formula | C19H17N3O5 |
| Molecular Weight | 367.36 g/mol |
| Exact Mass | 367.12 |
| IUPAC Name | 1',3',3'-trimethyl-5',6-dinitrospiro[chromene-2,2'-indole] |
| SMILES | CN1c2ccc([N+](=O)[O-])cc2C(C)(C)C12C=Cc1cc([N+](=O)[O-])ccc1O2 |
| InChI | InChI=1S/C19H17N3O5/c1-18(2)15-11-14(22(25)26)4-6-16(15)20(3)19(18)9-8-12-10-13(21(23)24)5-7-17(12)27-19/h4-11H,1-3H3 |
| InChIKey | WATJBQFTCSIDMV-UHFFFAOYSA-N |
| XLogP | 4.03 |
| TPSA | 98.75 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 367.36 |
| LogP ≤ 5 | 4.03 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|