About 4-[4-(4,5-dihydro-1,3-oxazol-2-yl)phenoxy]-1-(5-methylthiophen-2-yl)butan-1-one
4-[4-(4,5-dihydro-1,3-oxazol-2-yl)phenoxy]-1-(5-methylthiophen-2-yl)butan-1-one (PubChem CID 3007756) has the molecular formula C18H19NO3S
and a molecular weight of 329.42 g/mol. Its IUPAC name is 4-[4-(4,5-dihydro-1,3-oxazol-2-yl)phenoxy]-1-(5-methylthiophen-2-yl)butan-1-one.
Molecular Properties
| Compound Name | 4-[4-(4,5-dihydro-1,3-oxazol-2-yl)phenoxy]-1-(5-methylthiophen-2-yl)butan-1-one |
| PubChem CID | 3007756 |
| Molecular Formula | C18H19NO3S |
| Molecular Weight | 329.42 g/mol |
| Exact Mass | 329.11 |
| IUPAC Name | 4-[4-(4,5-dihydro-1,3-oxazol-2-yl)phenoxy]-1-(5-methylthiophen-2-yl)butan-1-one |
| SMILES | Cc1ccc(C(=O)CCCOc2ccc(C3=NCCO3)cc2)s1 |
| InChI | InChI=1S/C18H19NO3S/c1-13-4-9-17(23-13)16(20)3-2-11-21-15-7-5-14(6-8-15)18-19-10-12-22-18/h4-9H,2-3,10-12H2,1H3 |
| InChIKey | HCMOVEPNVAIBLN-UHFFFAOYSA-N |
| XLogP | 3.88 |
| TPSA | 47.89 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 23 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 329.42 |
| LogP ≤ 5 | 3.88 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|
Analyze 4-[4-(4,5-dihydro-1,3-oxazol-2-yl)phenoxy]-1-(5-methylthiophen-2-yl)butan-1-one with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 4-[4-(4,5-dihydro-1,3-oxazol-2-yl)phenoxy]-1-(5-methylthiophen-2-yl)butan-1-one?
The IUPAC name of 4-[4-(4,5-dihydro-1,3-oxazol-2-yl)phenoxy]-1-(5-methylthiophen-2-yl)butan-1-one (CID 3007756) is 4-[4-(4,5-dihydro-1,3-oxazol-2-yl)phenoxy]-1-(5-methylthiophen-2-yl)butan-1-one.
What is the SMILES notation for 4-[4-(4,5-dihydro-1,3-oxazol-2-yl)phenoxy]-1-(5-methylthiophen-2-yl)butan-1-one?
The canonical SMILES for 4-[4-(4,5-dihydro-1,3-oxazol-2-yl)phenoxy]-1-(5-methylthiophen-2-yl)butan-1-one is Cc1ccc(C(=O)CCCOc2ccc(C3=NCCO3)cc2)s1.
What is the InChIKey of 4-[4-(4,5-dihydro-1,3-oxazol-2-yl)phenoxy]-1-(5-methylthiophen-2-yl)butan-1-one?
The InChIKey is HCMOVEPNVAIBLN-UHFFFAOYSA-N. The full InChI is InChI=1S/C18H19NO3S/c1-13-4-9-17(23-13)16(20)3-2-11-21-15-7-5-14(6-8-15)18-19-10-12-22-18/h4-9H,2-3,10-12H2,1H3.
What are the key properties of 4-[4-(4,5-dihydro-1,3-oxazol-2-yl)phenoxy]-1-(5-methylthiophen-2-yl)butan-1-one?
4-[4-(4,5-dihydro-1,3-oxazol-2-yl)phenoxy]-1-(5-methylthiophen-2-yl)butan-1-one has a molecular weight of 329.42 g/mol, XLogP of 3.88, 7 rotatable bonds, 0 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for 4-[4-(4,5-dihydro-1,3-oxazol-2-yl)phenoxy]-1-(5-methylthiophen-2-yl)butan-1-one is sourced from PubChem (CID 3007756), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).