About 8-(1,3-thiazol-4-yl)-7H-purin-6-amine
8-(1,3-thiazol-4-yl)-7H-purin-6-amine (PubChem CID 3007767) has the molecular formula C8H6N6S
and a molecular weight of 218.25 g/mol. Its IUPAC name is 8-(1,3-thiazol-4-yl)-7H-purin-6-amine.
Molecular Properties
| Compound Name | 8-(1,3-thiazol-4-yl)-7H-purin-6-amine |
| PubChem CID | 3007767 |
| Molecular Formula | C8H6N6S |
| Molecular Weight | 218.25 g/mol |
| Exact Mass | 218.04 |
| IUPAC Name | 8-(1,3-thiazol-4-yl)-7H-purin-6-amine |
| SMILES | Nc1ncnc2nc(-c3cscn3)[nH]c12 |
| InChI | InChI=1S/C8H6N6S/c9-6-5-8(11-2-10-6)14-7(13-5)4-1-15-3-12-4/h1-3H,(H3,9,10,11,13,14) |
| InChIKey | WIUSWBSDLSUCNF-UHFFFAOYSA-N |
| XLogP | 1.06 |
| TPSA | 93.37 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 15 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 218.25 |
| LogP ≤ 5 | 1.06 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
Analyze 8-(1,3-thiazol-4-yl)-7H-purin-6-amine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 8-(1,3-thiazol-4-yl)-7H-purin-6-amine?
The IUPAC name of 8-(1,3-thiazol-4-yl)-7H-purin-6-amine (CID 3007767) is 8-(1,3-thiazol-4-yl)-7H-purin-6-amine.
What is the SMILES notation for 8-(1,3-thiazol-4-yl)-7H-purin-6-amine?
The canonical SMILES for 8-(1,3-thiazol-4-yl)-7H-purin-6-amine is Nc1ncnc2nc(-c3cscn3)[nH]c12.
What is the InChIKey of 8-(1,3-thiazol-4-yl)-7H-purin-6-amine?
The InChIKey is WIUSWBSDLSUCNF-UHFFFAOYSA-N. The full InChI is InChI=1S/C8H6N6S/c9-6-5-8(11-2-10-6)14-7(13-5)4-1-15-3-12-4/h1-3H,(H3,9,10,11,13,14).
What are the key properties of 8-(1,3-thiazol-4-yl)-7H-purin-6-amine?
8-(1,3-thiazol-4-yl)-7H-purin-6-amine has a molecular weight of 218.25 g/mol, XLogP of 1.06, 1 rotatable bonds, 2 hydrogen bond donors, and 6 hydrogen bond acceptors.
Where does this data come from?
All data for 8-(1,3-thiazol-4-yl)-7H-purin-6-amine is sourced from PubChem (CID 3007767), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).