C25H28F2N10O3 — CID 3007878
(2R,3S)-2-(2,4-difluorophenyl)-3-[5-[2-[4-(4-nitrophenyl)piperazin-1-yl]ethyl]tetrazol-2-yl]-1-(1,2,4-triazol-1-yl)butan-2-ol (PubChem CID 3007878) has the molecular formula C25H28F2N10O3 and a molecular weight of 554.56 g/mol. Its IUPAC name is (2R,3S)-2-(2,4-difluorophenyl)-3-[5-[2-[4-(4-nitrophenyl)piperazin-1-yl]ethyl]tetrazol-2-yl]-1-(1,2,4-triazol-1-yl)butan-2-ol.
| Compound Name | (2R,3S)-2-(2,4-difluorophenyl)-3-[5-[2-[4-(4-nitrophenyl)piperazin-1-yl]ethyl]tetrazol-2-yl]-1-(1,2,4-triazol-1-yl)butan-2-ol |
|---|---|
| PubChem CID | 3007878 |
| Molecular Formula | C25H28F2N10O3 |
| Molecular Weight | 554.56 g/mol |
| Exact Mass | 554.23 |
| IUPAC Name | (2R,3S)-2-(2,4-difluorophenyl)-3-[5-[2-[4-(4-nitrophenyl)piperazin-1-yl]ethyl]tetrazol-2-yl]-1-(1,2,4-triazol-1-yl)butan-2-ol |
| SMILES | C[C@H](n1nnc(CCN2CCN(c3ccc([N+](=O)[O-])cc3)CC2)n1)[C@](O)(Cn1cncn1)c1ccc(F)cc1F |
| InChI | InChI=1S/C25H28F2N10O3/c1-18(25(38,15-35-17-28-16-29-35)22-7-2-19(26)14-23(22)27)36-31-24(30-32-36)8-9-33-10-12-34(13-11-33)20-3-5-21(6-4-20)37(39)40/h2-7,14,16-18,38H,8-13,15H2,1H3/t18-,25+/m0/s1 |
| InChIKey | QNQSJWIXYQAVOZ-AVRWGWEMSA-N |
| XLogP | 1.96 |
| TPSA | 144.16 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 12 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 40 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 554.56 |
| LogP ≤ 5 | 1.96 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 12 |
| Structural Alerts | {'alert_name': 'anil_di_alk_A(478)', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|