About 6-(4,5-dihydro-1H-imidazol-2-yl)-2-[5-(4-nitrophenyl)furan-2-yl]-1H-benzimidazole
6-(4,5-dihydro-1H-imidazol-2-yl)-2-[5-(4-nitrophenyl)furan-2-yl]-1H-benzimidazole (PubChem CID 3007930) has the molecular formula C20H15N5O3
and a molecular weight of 373.37 g/mol. Its IUPAC name is 6-(4,5-dihydro-1H-imidazol-2-yl)-2-[5-(4-nitrophenyl)furan-2-yl]-1H-benzimidazole.
Molecular Properties
| Compound Name | 6-(4,5-dihydro-1H-imidazol-2-yl)-2-[5-(4-nitrophenyl)furan-2-yl]-1H-benzimidazole |
| PubChem CID | 3007930 |
| Molecular Formula | C20H15N5O3 |
| Molecular Weight | 373.37 g/mol |
| Exact Mass | 373.12 |
| IUPAC Name | 6-(4,5-dihydro-1H-imidazol-2-yl)-2-[5-(4-nitrophenyl)furan-2-yl]-1H-benzimidazole |
| SMILES | O=[N+]([O-])c1ccc(-c2ccc(-c3nc4ccc(C5=NCCN5)cc4[nH]3)o2)cc1 |
| InChI | InChI=1S/C20H15N5O3/c26-25(27)14-4-1-12(2-5-14)17-7-8-18(28-17)20-23-15-6-3-13(11-16(15)24-20)19-21-9-10-22-19/h1-8,11H,9-10H2,(H,21,22)(H,23,24) |
| InChIKey | RLMNYIZUGWGTHV-UHFFFAOYSA-N |
| XLogP | 3.75 |
| TPSA | 109.35 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 28 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 373.37 |
| LogP ≤ 5 | 3.75 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|
Analyze 6-(4,5-dihydro-1H-imidazol-2-yl)-2-[5-(4-nitrophenyl)furan-2-yl]-1H-benzimidazole with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 6-(4,5-dihydro-1H-imidazol-2-yl)-2-[5-(4-nitrophenyl)furan-2-yl]-1H-benzimidazole?
The IUPAC name of 6-(4,5-dihydro-1H-imidazol-2-yl)-2-[5-(4-nitrophenyl)furan-2-yl]-1H-benzimidazole (CID 3007930) is 6-(4,5-dihydro-1H-imidazol-2-yl)-2-[5-(4-nitrophenyl)furan-2-yl]-1H-benzimidazole.
What is the SMILES notation for 6-(4,5-dihydro-1H-imidazol-2-yl)-2-[5-(4-nitrophenyl)furan-2-yl]-1H-benzimidazole?
The canonical SMILES for 6-(4,5-dihydro-1H-imidazol-2-yl)-2-[5-(4-nitrophenyl)furan-2-yl]-1H-benzimidazole is O=[N+]([O-])c1ccc(-c2ccc(-c3nc4ccc(C5=NCCN5)cc4[nH]3)o2)cc1.
What is the InChIKey of 6-(4,5-dihydro-1H-imidazol-2-yl)-2-[5-(4-nitrophenyl)furan-2-yl]-1H-benzimidazole?
The InChIKey is RLMNYIZUGWGTHV-UHFFFAOYSA-N. The full InChI is InChI=1S/C20H15N5O3/c26-25(27)14-4-1-12(2-5-14)17-7-8-18(28-17)20-23-15-6-3-13(11-16(15)24-20)19-21-9-10-22-19/h1-8,11H,9-10H2,(H,21,22)(H,23,24).
What are the key properties of 6-(4,5-dihydro-1H-imidazol-2-yl)-2-[5-(4-nitrophenyl)furan-2-yl]-1H-benzimidazole?
6-(4,5-dihydro-1H-imidazol-2-yl)-2-[5-(4-nitrophenyl)furan-2-yl]-1H-benzimidazole has a molecular weight of 373.37 g/mol, XLogP of 3.75, 4 rotatable bonds, 2 hydrogen bond donors, and 6 hydrogen bond acceptors.
Where does this data come from?
All data for 6-(4,5-dihydro-1H-imidazol-2-yl)-2-[5-(4-nitrophenyl)furan-2-yl]-1H-benzimidazole is sourced from PubChem (CID 3007930), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).