About 2-[5-[4-(4,5-dihydro-1H-imidazol-2-yl)phenyl]furan-2-yl]-1H-benzimidazole
2-[5-[4-(4,5-dihydro-1H-imidazol-2-yl)phenyl]furan-2-yl]-1H-benzimidazole (PubChem CID 3007934) has the molecular formula C20H16N4O
and a molecular weight of 328.38 g/mol. Its IUPAC name is 2-[5-[4-(4,5-dihydro-1H-imidazol-2-yl)phenyl]furan-2-yl]-1H-benzimidazole.
Molecular Properties
| Compound Name | 2-[5-[4-(4,5-dihydro-1H-imidazol-2-yl)phenyl]furan-2-yl]-1H-benzimidazole |
| PubChem CID | 3007934 |
| Molecular Formula | C20H16N4O |
| Molecular Weight | 328.38 g/mol |
| Exact Mass | 328.13 |
| IUPAC Name | 2-[5-[4-(4,5-dihydro-1H-imidazol-2-yl)phenyl]furan-2-yl]-1H-benzimidazole |
| SMILES | c1ccc2[nH]c(-c3ccc(-c4ccc(C5=NCCN5)cc4)o3)nc2c1 |
| InChI | InChI=1S/C20H16N4O/c1-2-4-16-15(3-1)23-20(24-16)18-10-9-17(25-18)13-5-7-14(8-6-13)19-21-11-12-22-19/h1-10H,11-12H2,(H,21,22)(H,23,24) |
| InChIKey | XDFQDDCYYZDDDY-UHFFFAOYSA-N |
| XLogP | 3.84 |
| TPSA | 66.21 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 25 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 328.38 |
| LogP ≤ 5 | 3.84 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
Analyze 2-[5-[4-(4,5-dihydro-1H-imidazol-2-yl)phenyl]furan-2-yl]-1H-benzimidazole with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-[5-[4-(4,5-dihydro-1H-imidazol-2-yl)phenyl]furan-2-yl]-1H-benzimidazole?
The IUPAC name of 2-[5-[4-(4,5-dihydro-1H-imidazol-2-yl)phenyl]furan-2-yl]-1H-benzimidazole (CID 3007934) is 2-[5-[4-(4,5-dihydro-1H-imidazol-2-yl)phenyl]furan-2-yl]-1H-benzimidazole.
What is the SMILES notation for 2-[5-[4-(4,5-dihydro-1H-imidazol-2-yl)phenyl]furan-2-yl]-1H-benzimidazole?
The canonical SMILES for 2-[5-[4-(4,5-dihydro-1H-imidazol-2-yl)phenyl]furan-2-yl]-1H-benzimidazole is c1ccc2[nH]c(-c3ccc(-c4ccc(C5=NCCN5)cc4)o3)nc2c1.
What is the InChIKey of 2-[5-[4-(4,5-dihydro-1H-imidazol-2-yl)phenyl]furan-2-yl]-1H-benzimidazole?
The InChIKey is XDFQDDCYYZDDDY-UHFFFAOYSA-N. The full InChI is InChI=1S/C20H16N4O/c1-2-4-16-15(3-1)23-20(24-16)18-10-9-17(25-18)13-5-7-14(8-6-13)19-21-11-12-22-19/h1-10H,11-12H2,(H,21,22)(H,23,24).
What are the key properties of 2-[5-[4-(4,5-dihydro-1H-imidazol-2-yl)phenyl]furan-2-yl]-1H-benzimidazole?
2-[5-[4-(4,5-dihydro-1H-imidazol-2-yl)phenyl]furan-2-yl]-1H-benzimidazole has a molecular weight of 328.38 g/mol, XLogP of 3.84, 3 rotatable bonds, 2 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 2-[5-[4-(4,5-dihydro-1H-imidazol-2-yl)phenyl]furan-2-yl]-1H-benzimidazole is sourced from PubChem (CID 3007934), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).