About 2-(dimethylamino)ethyl N-(1-phenylethyl)carbamodithioate
2-(dimethylamino)ethyl N-(1-phenylethyl)carbamodithioate (PubChem CID 3008018) has the molecular formula C13H20N2S2
and a molecular weight of 268.45 g/mol. Its IUPAC name is 2-(dimethylamino)ethyl N-(1-phenylethyl)carbamodithioate.
Molecular Properties
| Compound Name | 2-(dimethylamino)ethyl N-(1-phenylethyl)carbamodithioate |
| PubChem CID | 3008018 |
| Molecular Formula | C13H20N2S2 |
| Molecular Weight | 268.45 g/mol |
| Exact Mass | 268.11 |
| IUPAC Name | 2-(dimethylamino)ethyl N-(1-phenylethyl)carbamodithioate |
| SMILES | CC(NC(=S)SCCN(C)C)c1ccccc1 |
| InChI | InChI=1S/C13H20N2S2/c1-11(12-7-5-4-6-8-12)14-13(16)17-10-9-15(2)3/h4-8,11H,9-10H2,1-3H3,(H,14,16) |
| InChIKey | HUXMBUYFJVTFGK-UHFFFAOYSA-N |
| XLogP | 2.92 |
| TPSA | 15.27 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 17 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 268.45 |
| LogP ≤ 5 | 2.92 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|
Analyze 2-(dimethylamino)ethyl N-(1-phenylethyl)carbamodithioate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-(dimethylamino)ethyl N-(1-phenylethyl)carbamodithioate?
The IUPAC name of 2-(dimethylamino)ethyl N-(1-phenylethyl)carbamodithioate (CID 3008018) is 2-(dimethylamino)ethyl N-(1-phenylethyl)carbamodithioate.
What is the SMILES notation for 2-(dimethylamino)ethyl N-(1-phenylethyl)carbamodithioate?
The canonical SMILES for 2-(dimethylamino)ethyl N-(1-phenylethyl)carbamodithioate is CC(NC(=S)SCCN(C)C)c1ccccc1.
What is the InChIKey of 2-(dimethylamino)ethyl N-(1-phenylethyl)carbamodithioate?
The InChIKey is HUXMBUYFJVTFGK-UHFFFAOYSA-N. The full InChI is InChI=1S/C13H20N2S2/c1-11(12-7-5-4-6-8-12)14-13(16)17-10-9-15(2)3/h4-8,11H,9-10H2,1-3H3,(H,14,16).
What are the key properties of 2-(dimethylamino)ethyl N-(1-phenylethyl)carbamodithioate?
2-(dimethylamino)ethyl N-(1-phenylethyl)carbamodithioate has a molecular weight of 268.45 g/mol, XLogP of 2.92, 5 rotatable bonds, 1 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 2-(dimethylamino)ethyl N-(1-phenylethyl)carbamodithioate is sourced from PubChem (CID 3008018), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).