About 2-(diethylamino)ethyl N-[(4-methylphenyl)methyl]carbamodithioate
2-(diethylamino)ethyl N-[(4-methylphenyl)methyl]carbamodithioate (PubChem CID 3008022) has the molecular formula C15H24N2S2
and a molecular weight of 296.50 g/mol. Its IUPAC name is 2-(diethylamino)ethyl N-[(4-methylphenyl)methyl]carbamodithioate.
Molecular Properties
| Compound Name | 2-(diethylamino)ethyl N-[(4-methylphenyl)methyl]carbamodithioate |
| PubChem CID | 3008022 |
| Molecular Formula | C15H24N2S2 |
| Molecular Weight | 296.50 g/mol |
| Exact Mass | 296.14 |
| IUPAC Name | 2-(diethylamino)ethyl N-[(4-methylphenyl)methyl]carbamodithioate |
| SMILES | CCN(CC)CCSC(=S)NCc1ccc(C)cc1 |
| InChI | InChI=1S/C15H24N2S2/c1-4-17(5-2)10-11-19-15(18)16-12-14-8-6-13(3)7-9-14/h6-9H,4-5,10-12H2,1-3H3,(H,16,18) |
| InChIKey | AYEBKUQGKZEZCM-UHFFFAOYSA-N |
| XLogP | 3.44 |
| TPSA | 15.27 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 19 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 296.50 |
| LogP ≤ 5 | 3.44 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'thio_carbam_A(1)', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|
Analyze 2-(diethylamino)ethyl N-[(4-methylphenyl)methyl]carbamodithioate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-(diethylamino)ethyl N-[(4-methylphenyl)methyl]carbamodithioate?
The IUPAC name of 2-(diethylamino)ethyl N-[(4-methylphenyl)methyl]carbamodithioate (CID 3008022) is 2-(diethylamino)ethyl N-[(4-methylphenyl)methyl]carbamodithioate.
What is the SMILES notation for 2-(diethylamino)ethyl N-[(4-methylphenyl)methyl]carbamodithioate?
The canonical SMILES for 2-(diethylamino)ethyl N-[(4-methylphenyl)methyl]carbamodithioate is CCN(CC)CCSC(=S)NCc1ccc(C)cc1.
What is the InChIKey of 2-(diethylamino)ethyl N-[(4-methylphenyl)methyl]carbamodithioate?
The InChIKey is AYEBKUQGKZEZCM-UHFFFAOYSA-N. The full InChI is InChI=1S/C15H24N2S2/c1-4-17(5-2)10-11-19-15(18)16-12-14-8-6-13(3)7-9-14/h6-9H,4-5,10-12H2,1-3H3,(H,16,18).
What are the key properties of 2-(diethylamino)ethyl N-[(4-methylphenyl)methyl]carbamodithioate?
2-(diethylamino)ethyl N-[(4-methylphenyl)methyl]carbamodithioate has a molecular weight of 296.50 g/mol, XLogP of 3.44, 7 rotatable bonds, 1 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 2-(diethylamino)ethyl N-[(4-methylphenyl)methyl]carbamodithioate is sourced from PubChem (CID 3008022), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).