About 2-(dimethylamino)ethyl N-[(4-tert-butylphenyl)methyl]carbamodithioate
2-(dimethylamino)ethyl N-[(4-tert-butylphenyl)methyl]carbamodithioate (PubChem CID 3008024) has the molecular formula C16H26N2S2
and a molecular weight of 310.53 g/mol. Its IUPAC name is 2-(dimethylamino)ethyl N-[(4-tert-butylphenyl)methyl]carbamodithioate.
Molecular Properties
| Compound Name | 2-(dimethylamino)ethyl N-[(4-tert-butylphenyl)methyl]carbamodithioate |
| PubChem CID | 3008024 |
| Molecular Formula | C16H26N2S2 |
| Molecular Weight | 310.53 g/mol |
| Exact Mass | 310.15 |
| IUPAC Name | 2-(dimethylamino)ethyl N-[(4-tert-butylphenyl)methyl]carbamodithioate |
| SMILES | CN(C)CCSC(=S)NCc1ccc(C(C)(C)C)cc1 |
| InChI | InChI=1S/C16H26N2S2/c1-16(2,3)14-8-6-13(7-9-14)12-17-15(19)20-11-10-18(4)5/h6-9H,10-12H2,1-5H3,(H,17,19) |
| InChIKey | JGFZKQOCMMCNAD-UHFFFAOYSA-N |
| XLogP | 3.65 |
| TPSA | 15.27 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 20 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 310.53 |
| LogP ≤ 5 | 3.65 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'thio_carbam_A(1)', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|
Analyze 2-(dimethylamino)ethyl N-[(4-tert-butylphenyl)methyl]carbamodithioate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-(dimethylamino)ethyl N-[(4-tert-butylphenyl)methyl]carbamodithioate?
The IUPAC name of 2-(dimethylamino)ethyl N-[(4-tert-butylphenyl)methyl]carbamodithioate (CID 3008024) is 2-(dimethylamino)ethyl N-[(4-tert-butylphenyl)methyl]carbamodithioate.
What is the SMILES notation for 2-(dimethylamino)ethyl N-[(4-tert-butylphenyl)methyl]carbamodithioate?
The canonical SMILES for 2-(dimethylamino)ethyl N-[(4-tert-butylphenyl)methyl]carbamodithioate is CN(C)CCSC(=S)NCc1ccc(C(C)(C)C)cc1.
What is the InChIKey of 2-(dimethylamino)ethyl N-[(4-tert-butylphenyl)methyl]carbamodithioate?
The InChIKey is JGFZKQOCMMCNAD-UHFFFAOYSA-N. The full InChI is InChI=1S/C16H26N2S2/c1-16(2,3)14-8-6-13(7-9-14)12-17-15(19)20-11-10-18(4)5/h6-9H,10-12H2,1-5H3,(H,17,19).
What are the key properties of 2-(dimethylamino)ethyl N-[(4-tert-butylphenyl)methyl]carbamodithioate?
2-(dimethylamino)ethyl N-[(4-tert-butylphenyl)methyl]carbamodithioate has a molecular weight of 310.53 g/mol, XLogP of 3.65, 5 rotatable bonds, 1 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 2-(dimethylamino)ethyl N-[(4-tert-butylphenyl)methyl]carbamodithioate is sourced from PubChem (CID 3008024), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).