About 6,8-dichloro-3-(4-methylphenyl)-1,3-benzoxazine-2,4-dithione
6,8-dichloro-3-(4-methylphenyl)-1,3-benzoxazine-2,4-dithione (PubChem CID 3008077) has the molecular formula C15H9Cl2NOS2
and a molecular weight of 354.28 g/mol. Its IUPAC name is 6,8-dichloro-3-(4-methylphenyl)-1,3-benzoxazine-2,4-dithione.
Molecular Properties
| Compound Name | 6,8-dichloro-3-(4-methylphenyl)-1,3-benzoxazine-2,4-dithione |
| PubChem CID | 3008077 |
| Molecular Formula | C15H9Cl2NOS2 |
| Molecular Weight | 354.28 g/mol |
| Exact Mass | 352.95 |
| IUPAC Name | 6,8-dichloro-3-(4-methylphenyl)-1,3-benzoxazine-2,4-dithione |
| SMILES | Cc1ccc(-n2c(=S)oc3c(Cl)cc(Cl)cc3c2=S)cc1 |
| InChI | InChI=1S/C15H9Cl2NOS2/c1-8-2-4-10(5-3-8)18-14(20)11-6-9(16)7-12(17)13(11)19-15(18)21/h2-7H,1H3 |
| InChIKey | FKPHBISTHOMACK-UHFFFAOYSA-N |
| XLogP | 6.30 |
| TPSA | 18.07 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 21 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 354.28 |
| LogP ≤ 5 | 6.30 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|
Analyze 6,8-dichloro-3-(4-methylphenyl)-1,3-benzoxazine-2,4-dithione with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 6,8-dichloro-3-(4-methylphenyl)-1,3-benzoxazine-2,4-dithione?
The IUPAC name of 6,8-dichloro-3-(4-methylphenyl)-1,3-benzoxazine-2,4-dithione (CID 3008077) is 6,8-dichloro-3-(4-methylphenyl)-1,3-benzoxazine-2,4-dithione.
What is the SMILES notation for 6,8-dichloro-3-(4-methylphenyl)-1,3-benzoxazine-2,4-dithione?
The canonical SMILES for 6,8-dichloro-3-(4-methylphenyl)-1,3-benzoxazine-2,4-dithione is Cc1ccc(-n2c(=S)oc3c(Cl)cc(Cl)cc3c2=S)cc1.
What is the InChIKey of 6,8-dichloro-3-(4-methylphenyl)-1,3-benzoxazine-2,4-dithione?
The InChIKey is FKPHBISTHOMACK-UHFFFAOYSA-N. The full InChI is InChI=1S/C15H9Cl2NOS2/c1-8-2-4-10(5-3-8)18-14(20)11-6-9(16)7-12(17)13(11)19-15(18)21/h2-7H,1H3.
What are the key properties of 6,8-dichloro-3-(4-methylphenyl)-1,3-benzoxazine-2,4-dithione?
6,8-dichloro-3-(4-methylphenyl)-1,3-benzoxazine-2,4-dithione has a molecular weight of 354.28 g/mol, XLogP of 6.30, 1 rotatable bonds, 0 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 6,8-dichloro-3-(4-methylphenyl)-1,3-benzoxazine-2,4-dithione is sourced from PubChem (CID 3008077), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).