C17H20O4S — CID 3008222
6-(2-hydroxyethoxymethyl)-4-methyl-5-(2-methylphenyl)sulfanylcyclohex-4-ene-1,3-dione (PubChem CID 3008222) has the molecular formula C17H20O4S and a molecular weight of 320.41 g/mol. Its IUPAC name is 6-(2-hydroxyethoxymethyl)-4-methyl-5-(2-methylphenyl)sulfanylcyclohex-4-ene-1,3-dione.
| Compound Name | 6-(2-hydroxyethoxymethyl)-4-methyl-5-(2-methylphenyl)sulfanylcyclohex-4-ene-1,3-dione |
|---|---|
| PubChem CID | 3008222 |
| Molecular Formula | C17H20O4S |
| Molecular Weight | 320.41 g/mol |
| Exact Mass | 320.11 |
| IUPAC Name | 6-(2-hydroxyethoxymethyl)-4-methyl-5-(2-methylphenyl)sulfanylcyclohex-4-ene-1,3-dione |
| SMILES | CC1=C(Sc2ccccc2C)C(COCCO)C(=O)CC1=O |
| InChI | InChI=1S/C17H20O4S/c1-11-5-3-4-6-16(11)22-17-12(2)14(19)9-15(20)13(17)10-21-8-7-18/h3-6,13,18H,7-10H2,1-2H3 |
| InChIKey | RCWLNXLGGLTSES-UHFFFAOYSA-N |
| XLogP | 2.53 |
| TPSA | 63.60 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 320.41 |
| LogP ≤ 5 | 2.53 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'} |
|---|