About 2,4-diphenoxypyrimidine
2,4-diphenoxypyrimidine (PubChem CID 3008436) has the molecular formula C16H12N2O2
and a molecular weight of 264.28 g/mol. Its IUPAC name is 2,4-diphenoxypyrimidine.
Molecular Properties
| Compound Name | 2,4-diphenoxypyrimidine |
| PubChem CID | 3008436 |
| Molecular Formula | C16H12N2O2 |
| Molecular Weight | 264.28 g/mol |
| Exact Mass | 264.09 |
| IUPAC Name | 2,4-diphenoxypyrimidine |
| SMILES | c1ccc(Oc2ccnc(Oc3ccccc3)n2)cc1 |
| InChI | InChI=1S/C16H12N2O2/c1-3-7-13(8-4-1)19-15-11-12-17-16(18-15)20-14-9-5-2-6-10-14/h1-12H |
| InChIKey | LLUGOATVEGVYDT-UHFFFAOYSA-N |
| XLogP | 4.06 |
| TPSA | 44.24 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 20 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 264.28 |
| LogP ≤ 5 | 4.06 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
Analyze 2,4-diphenoxypyrimidine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2,4-diphenoxypyrimidine?
The IUPAC name of 2,4-diphenoxypyrimidine (CID 3008436) is 2,4-diphenoxypyrimidine.
What is the SMILES notation for 2,4-diphenoxypyrimidine?
The canonical SMILES for 2,4-diphenoxypyrimidine is c1ccc(Oc2ccnc(Oc3ccccc3)n2)cc1.
What is the InChIKey of 2,4-diphenoxypyrimidine?
The InChIKey is LLUGOATVEGVYDT-UHFFFAOYSA-N. The full InChI is InChI=1S/C16H12N2O2/c1-3-7-13(8-4-1)19-15-11-12-17-16(18-15)20-14-9-5-2-6-10-14/h1-12H.
What are the key properties of 2,4-diphenoxypyrimidine?
2,4-diphenoxypyrimidine has a molecular weight of 264.28 g/mol, XLogP of 4.06, 4 rotatable bonds, 0 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 2,4-diphenoxypyrimidine is sourced from PubChem (CID 3008436), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).