About 5-methyl-2,4-diphenoxypyrimidine
5-methyl-2,4-diphenoxypyrimidine (PubChem CID 3008442) has the molecular formula C17H14N2O2
and a molecular weight of 278.31 g/mol. Its IUPAC name is 5-methyl-2,4-diphenoxypyrimidine.
Molecular Properties
| Compound Name | 5-methyl-2,4-diphenoxypyrimidine |
| PubChem CID | 3008442 |
| Molecular Formula | C17H14N2O2 |
| Molecular Weight | 278.31 g/mol |
| Exact Mass | 278.11 |
| IUPAC Name | 5-methyl-2,4-diphenoxypyrimidine |
| SMILES | Cc1cnc(Oc2ccccc2)nc1Oc1ccccc1 |
| InChI | InChI=1S/C17H14N2O2/c1-13-12-18-17(21-15-10-6-3-7-11-15)19-16(13)20-14-8-4-2-5-9-14/h2-12H,1H3 |
| InChIKey | PKUIERHEKOUWQG-UHFFFAOYSA-N |
| XLogP | 4.37 |
| TPSA | 44.24 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 21 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 278.31 |
| LogP ≤ 5 | 4.37 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
Analyze 5-methyl-2,4-diphenoxypyrimidine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 5-methyl-2,4-diphenoxypyrimidine?
The IUPAC name of 5-methyl-2,4-diphenoxypyrimidine (CID 3008442) is 5-methyl-2,4-diphenoxypyrimidine.
What is the SMILES notation for 5-methyl-2,4-diphenoxypyrimidine?
The canonical SMILES for 5-methyl-2,4-diphenoxypyrimidine is Cc1cnc(Oc2ccccc2)nc1Oc1ccccc1.
What is the InChIKey of 5-methyl-2,4-diphenoxypyrimidine?
The InChIKey is PKUIERHEKOUWQG-UHFFFAOYSA-N. The full InChI is InChI=1S/C17H14N2O2/c1-13-12-18-17(21-15-10-6-3-7-11-15)19-16(13)20-14-8-4-2-5-9-14/h2-12H,1H3.
What are the key properties of 5-methyl-2,4-diphenoxypyrimidine?
5-methyl-2,4-diphenoxypyrimidine has a molecular weight of 278.31 g/mol, XLogP of 4.37, 4 rotatable bonds, 0 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 5-methyl-2,4-diphenoxypyrimidine is sourced from PubChem (CID 3008442), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).