C10H12Cl2N2O2S — CID 3008572
2-[1-(3,4-dichlorophenyl)-2-nitroethyl]sulfanylethanamine (PubChem CID 3008572) has the molecular formula C10H12Cl2N2O2S and a molecular weight of 295.19 g/mol. Its IUPAC name is 2-[1-(3,4-dichlorophenyl)-2-nitroethyl]sulfanylethanamine.
| Compound Name | 2-[1-(3,4-dichlorophenyl)-2-nitroethyl]sulfanylethanamine |
|---|---|
| PubChem CID | 3008572 |
| Molecular Formula | C10H12Cl2N2O2S |
| Molecular Weight | 295.19 g/mol |
| Exact Mass | 294.00 |
| IUPAC Name | 2-[1-(3,4-dichlorophenyl)-2-nitroethyl]sulfanylethanamine |
| SMILES | NCCSC(C[N+](=O)[O-])c1ccc(Cl)c(Cl)c1 |
| InChI | InChI=1S/C10H12Cl2N2O2S/c11-8-2-1-7(5-9(8)12)10(6-14(15)16)17-4-3-13/h1-2,5,10H,3-4,6,13H2 |
| InChIKey | FKGRURNQNOQZGH-UHFFFAOYSA-N |
| XLogP | 3.00 |
| TPSA | 69.16 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 295.19 |
| LogP ≤ 5 | 3.00 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|