About (2,4-diaminoquinazolin-6-yl)methyl anthracene-9-carboxylate
(2,4-diaminoquinazolin-6-yl)methyl anthracene-9-carboxylate (PubChem CID 3008593) has the molecular formula C24H18N4O2
and a molecular weight of 394.43 g/mol. Its IUPAC name is (2,4-diaminoquinazolin-6-yl)methyl anthracene-9-carboxylate.
Molecular Properties
| Compound Name | (2,4-diaminoquinazolin-6-yl)methyl anthracene-9-carboxylate |
| PubChem CID | 3008593 |
| Molecular Formula | C24H18N4O2 |
| Molecular Weight | 394.43 g/mol |
| Exact Mass | 394.14 |
| IUPAC Name | (2,4-diaminoquinazolin-6-yl)methyl anthracene-9-carboxylate |
| SMILES | Nc1nc(N)c2cc(COC(=O)c3c4ccccc4cc4ccccc34)ccc2n1 |
| InChI | InChI=1S/C24H18N4O2/c25-22-19-11-14(9-10-20(19)27-24(26)28-22)13-30-23(29)21-17-7-3-1-5-15(17)12-16-6-2-4-8-18(16)21/h1-12H,13H2,(H4,25,26,27,28) |
| InChIKey | DUFFXUSUXDWRER-UHFFFAOYSA-N |
| XLogP | 4.46 |
| TPSA | 104.12 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 30 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 394.43 |
| LogP ≤ 5 | 4.46 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Polycyclic_aromatic_hydrocarbon_2', 'substructure': 'N/A'} |
|---|
Analyze (2,4-diaminoquinazolin-6-yl)methyl anthracene-9-carboxylate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (2,4-diaminoquinazolin-6-yl)methyl anthracene-9-carboxylate?
The IUPAC name of (2,4-diaminoquinazolin-6-yl)methyl anthracene-9-carboxylate (CID 3008593) is (2,4-diaminoquinazolin-6-yl)methyl anthracene-9-carboxylate.
What is the SMILES notation for (2,4-diaminoquinazolin-6-yl)methyl anthracene-9-carboxylate?
The canonical SMILES for (2,4-diaminoquinazolin-6-yl)methyl anthracene-9-carboxylate is Nc1nc(N)c2cc(COC(=O)c3c4ccccc4cc4ccccc34)ccc2n1.
What is the InChIKey of (2,4-diaminoquinazolin-6-yl)methyl anthracene-9-carboxylate?
The InChIKey is DUFFXUSUXDWRER-UHFFFAOYSA-N. The full InChI is InChI=1S/C24H18N4O2/c25-22-19-11-14(9-10-20(19)27-24(26)28-22)13-30-23(29)21-17-7-3-1-5-15(17)12-16-6-2-4-8-18(16)21/h1-12H,13H2,(H4,25,26,27,28).
What are the key properties of (2,4-diaminoquinazolin-6-yl)methyl anthracene-9-carboxylate?
(2,4-diaminoquinazolin-6-yl)methyl anthracene-9-carboxylate has a molecular weight of 394.43 g/mol, XLogP of 4.46, 3 rotatable bonds, 2 hydrogen bond donors, and 6 hydrogen bond acceptors.
Where does this data come from?
All data for (2,4-diaminoquinazolin-6-yl)methyl anthracene-9-carboxylate is sourced from PubChem (CID 3008593), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).