About (2,4-diaminoquinazolin-6-yl)methyl 2-phenylbenzoate
(2,4-diaminoquinazolin-6-yl)methyl 2-phenylbenzoate (PubChem CID 3008596) has the molecular formula C22H18N4O2
and a molecular weight of 370.41 g/mol. Its IUPAC name is (2,4-diaminoquinazolin-6-yl)methyl 2-phenylbenzoate.
Molecular Properties
| Compound Name | (2,4-diaminoquinazolin-6-yl)methyl 2-phenylbenzoate |
| PubChem CID | 3008596 |
| Molecular Formula | C22H18N4O2 |
| Molecular Weight | 370.41 g/mol |
| Exact Mass | 370.14 |
| IUPAC Name | (2,4-diaminoquinazolin-6-yl)methyl 2-phenylbenzoate |
| SMILES | Nc1nc(N)c2cc(COC(=O)c3ccccc3-c3ccccc3)ccc2n1 |
| InChI | InChI=1S/C22H18N4O2/c23-20-18-12-14(10-11-19(18)25-22(24)26-20)13-28-21(27)17-9-5-4-8-16(17)15-6-2-1-3-7-15/h1-12H,13H2,(H4,23,24,25,26) |
| InChIKey | NUOGRQREONWYHR-UHFFFAOYSA-N |
| XLogP | 3.82 |
| TPSA | 104.12 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 28 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 370.41 |
| LogP ≤ 5 | 3.82 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
Analyze (2,4-diaminoquinazolin-6-yl)methyl 2-phenylbenzoate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (2,4-diaminoquinazolin-6-yl)methyl 2-phenylbenzoate?
The IUPAC name of (2,4-diaminoquinazolin-6-yl)methyl 2-phenylbenzoate (CID 3008596) is (2,4-diaminoquinazolin-6-yl)methyl 2-phenylbenzoate.
What is the SMILES notation for (2,4-diaminoquinazolin-6-yl)methyl 2-phenylbenzoate?
The canonical SMILES for (2,4-diaminoquinazolin-6-yl)methyl 2-phenylbenzoate is Nc1nc(N)c2cc(COC(=O)c3ccccc3-c3ccccc3)ccc2n1.
What is the InChIKey of (2,4-diaminoquinazolin-6-yl)methyl 2-phenylbenzoate?
The InChIKey is NUOGRQREONWYHR-UHFFFAOYSA-N. The full InChI is InChI=1S/C22H18N4O2/c23-20-18-12-14(10-11-19(18)25-22(24)26-20)13-28-21(27)17-9-5-4-8-16(17)15-6-2-1-3-7-15/h1-12H,13H2,(H4,23,24,25,26).
What are the key properties of (2,4-diaminoquinazolin-6-yl)methyl 2-phenylbenzoate?
(2,4-diaminoquinazolin-6-yl)methyl 2-phenylbenzoate has a molecular weight of 370.41 g/mol, XLogP of 3.82, 4 rotatable bonds, 2 hydrogen bond donors, and 6 hydrogen bond acceptors.
Where does this data come from?
All data for (2,4-diaminoquinazolin-6-yl)methyl 2-phenylbenzoate is sourced from PubChem (CID 3008596), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).