About (2,4-diaminoquinazolin-6-yl)methyl 3-iodobenzoate
(2,4-diaminoquinazolin-6-yl)methyl 3-iodobenzoate (PubChem CID 3008598) has the molecular formula C16H13IN4O2
and a molecular weight of 420.21 g/mol. Its IUPAC name is (2,4-diaminoquinazolin-6-yl)methyl 3-iodobenzoate.
Molecular Properties
| Compound Name | (2,4-diaminoquinazolin-6-yl)methyl 3-iodobenzoate |
| PubChem CID | 3008598 |
| Molecular Formula | C16H13IN4O2 |
| Molecular Weight | 420.21 g/mol |
| Exact Mass | 420.01 |
| IUPAC Name | (2,4-diaminoquinazolin-6-yl)methyl 3-iodobenzoate |
| SMILES | Nc1nc(N)c2cc(COC(=O)c3cccc(I)c3)ccc2n1 |
| InChI | InChI=1S/C16H13IN4O2/c17-11-3-1-2-10(7-11)15(22)23-8-9-4-5-13-12(6-9)14(18)21-16(19)20-13/h1-7H,8H2,(H4,18,19,20,21) |
| InChIKey | JAUSDPCFKKVSMI-UHFFFAOYSA-N |
| XLogP | 2.76 |
| TPSA | 104.12 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 23 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 420.21 |
| LogP ≤ 5 | 2.76 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|
Analyze (2,4-diaminoquinazolin-6-yl)methyl 3-iodobenzoate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (2,4-diaminoquinazolin-6-yl)methyl 3-iodobenzoate?
The IUPAC name of (2,4-diaminoquinazolin-6-yl)methyl 3-iodobenzoate (CID 3008598) is (2,4-diaminoquinazolin-6-yl)methyl 3-iodobenzoate.
What is the SMILES notation for (2,4-diaminoquinazolin-6-yl)methyl 3-iodobenzoate?
The canonical SMILES for (2,4-diaminoquinazolin-6-yl)methyl 3-iodobenzoate is Nc1nc(N)c2cc(COC(=O)c3cccc(I)c3)ccc2n1.
What is the InChIKey of (2,4-diaminoquinazolin-6-yl)methyl 3-iodobenzoate?
The InChIKey is JAUSDPCFKKVSMI-UHFFFAOYSA-N. The full InChI is InChI=1S/C16H13IN4O2/c17-11-3-1-2-10(7-11)15(22)23-8-9-4-5-13-12(6-9)14(18)21-16(19)20-13/h1-7H,8H2,(H4,18,19,20,21).
What are the key properties of (2,4-diaminoquinazolin-6-yl)methyl 3-iodobenzoate?
(2,4-diaminoquinazolin-6-yl)methyl 3-iodobenzoate has a molecular weight of 420.21 g/mol, XLogP of 2.76, 3 rotatable bonds, 2 hydrogen bond donors, and 6 hydrogen bond acceptors.
Where does this data come from?
All data for (2,4-diaminoquinazolin-6-yl)methyl 3-iodobenzoate is sourced from PubChem (CID 3008598), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).